Schizanthine G

Schizanthine G

Inquiry
Catalog Number ACM119736742
CAS Number 119736-74-2
Structure
Synonyms Butanedioic acid, methylene-, 1-methyl 4-[(1R,3R,5S,6R)-8-methyl-6-[[(2E)-2-methyl-1-oxo-2-butenyl]oxy]-8-azabicyclo[3.2.1]oct-3-yl] ester (9CI)
Molecular Weight 365.4
InChI InChI=1S/C19H27NO6/c1-6-11(2)19(23)26-16-9-13-8-14(10-15(16)20(13)4)25-17(21)7-12(3)18(22)24-5/h6,13-16H,3,7-10H2,1-2,4-5H3/b11-6+/t13,14-,15,16-/m1/s1
InChI Key AOYQAZNNRNVKSE-JQESXHTISA-N
Purity 95%+
Complexity 626
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 2
Exact Mass 365.18383758
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 7
Hydrogen Bond Donor Count 0
Isomeric SMILES C/C=C(\C)/C(=O)O[C@@H]1CC2C[C@H](CC1N2C)OC(=O)CC(=C)C(=O)OC
Monoisotopic Mass 365.18383758
PhysicalState Powder
Rotatable Bond Count 9
Topological Polar Surface Area 82.1 Ų
Custom Q&A

What is the product name of the chemical compound with CAS number 119736-74-2?

Schizanthine G

What are some synonyms for Schizanthine G?

Butanedioic acid, methylene-, 1-methyl 4-[(1R,3R,5S,6R)-8-methyl-6-[[(2E)-2-methyl-1-oxo-2-butenyl]oxy]-8-azabicyclo[3.2.1]oct-3-yl] ester (9CI)

What is the molecular formula of Schizanthine G?

C19H27NO6

What is the molecular weight of Schizanthine G?

365.42

What is the predicted boiling point of Schizanthine G?

446.8±45.0 °C

What is the predicted density of Schizanthine G?

1.17±0.1 g/cm3

What is the predicted pKa value of Schizanthine G?

7.88±0.60

What is the predicted molar mass of Schizanthine G?

365.42 g/mol

What is the predicted boiling point range of Schizanthine G?

446.8±45.0 °C

What is the predicted pKa value range of Schizanthine G?

7.88±0.60

※ Please kindly note that our products are for research use only.