Scopine

Catalog Number	ACM498453
CAS Number	498-45-3
Structure
Synonyms	6,7-Epoxytropine
Molecular Weight	155.19
InChI	InChI=1S/C8H13NO2/c1-9-5-2-4(10)3-6(9)8-7(5)11-8/h4-8,10H,2-3H2,1H3/t4,5-,6+,7-,8+
InChI Key	FIMXSEMBHGTNKT-UPGAHCIJSA-N
Melting Point	73-77 °C
Purity	95%+
Complexity	179
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	155.094628657
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)O
Monoisotopic Mass	155.094628657
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	36 Ų

Custom Q&A

What is the chemical formula of scopine?

The chemical formula of scopine is C8H13NO2.

What is the melting point of scopine?

The melting point of scopine is 73.0 to 77.0 °C.

What are some synonyms for scopine?

Some synonyms for scopine include SCOPINE, (1α,2β,4β,5α)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7β-ol, and Atropine Impurity 2.

What is the storage recommendation for scopine?

It is recommended to store scopine in a freezer under -20°C in an inert atmosphere.

What are the solubility properties of scopine?

Scopine is soluble in dichloromethane and methanol.

What is the biological activity of scopine?

Scopine is the metabolite of anisodine, which is a α1-adrenergic receptor agonist used in the treatment of acute circulatory shock.

What is scopine used for in synthesis?

Scopine is used as an Intermediate in the synthesis of Scopine Methobromide, an impurity of Tiotropium, a muscarinic receptor antagonist and bronchodilator.

How is scopine classified in terms of HS Code?

Scopine is classified under HS Code 29349990.

What is the predicted boiling point of scopine?

The predicted boiling point of scopine is 281.3±40.0 °C.

How is scopine commonly found in terms of form?

Scopine is commonly found in the form of white to white crystal powder.

※ Please kindly note that our products are for research use only.