Scorpioidine

Catalog Number	ACM80405181
CAS Number	80405-18-1
Molecular Weight	381.5
InChI	InChI=1S/C20H31NO6/c1-6-13(4)18(23)27-14(5)20(25,12(2)3)19(24)26-11-15-7-9-21-10-8-16(22)17(15)21/h6-7,12,14,16-17,22,25H,8-11H2,1-5H3/b13-6+/t14-,16+,17+,20-/m0/s1
InChI Key	XDYWDZKXDBKDDT-SMLWLWDZSA-N
Purity	95%+
Complexity	640
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	381.21513771
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C(\C)/C(=O)O[C@@H](C)[C@@](C(C)C)(C(=O)OCC1=CCN2[C@H]1[C@@H](CC2)O)O
Monoisotopic Mass	381.21513771
PhysicalState	Powder
Rotatable Bond Count	9
Topological Polar Surface Area	96.3 Ų

Custom Q&A

What is the product name of the biomolecule with the chemical formula C20H31NO6?

The product name is Scorpioidine.

What are some synonyms for Scorpioidine?

Some synonyms for Scorpioidine are 2-Butenoic acid, 2-methyl-, and (1S,2S)-2-hydroxy-1,3-dimethyl-2-[[[(1R,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl]methoxy]carbonyl]butyl ester, (2E)-.

What is the CAS number for Scorpioidine?

The CAS number for Scorpioidine is 80405-18-1.

What is the molecular formula of Scorpioidine?

The molecular formula of Scorpioidine is C20H31NO6.

What is the molecular weight of Scorpioidine?

The molecular weight of Scorpioidine is 381.46.

Is Scorpioidine a biomolecule?

Yes, Scorpioidine is a biomolecule.

What is the chemical structure of Scorpioidine?

The chemical structure of Scorpioidine consists of a 2-methyl-2-butenoic acid ester attached to a pyrrolizidine alkaloid moiety.

How is Scorpioidine synthesized?

Scorpioidine is a natural product that is biosynthesized in certain organisms.

What are some potential applications of Scorpioidine?

Scorpioidine may have pharmaceutical applications due to its unique structure and properties.

Are there any known side effects or hazards associated with Scorpioidine?

Further research may be needed to determine any potential side effects or hazards associated with Scorpioidine.

※ Please kindly note that our products are for research use only.