Selagine

Catalog Number	ACM102518796-3
CAS Number	102518-79-6
Structure
Synonyms	HupA
IUPAC Name	(1R,9R)-1-Amino-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one
Molecular Weight	242.32
Molecular Formula	C15H18N2O
Canonical SMILES	CC=C1C2CC3=C(C1(CC(=C2)C)N)C=CC(=O)N3
InChI	InChI=1S/C15H18N2O/c1-3-11-10-6-9(2)8-15(11,16)12-4-5-14(18)17-13(12)7-10/h3-6,10H,7-8,16H2,1-2H3,(H,17,18)/t10-,15+/m0/s1
InChI Key	ZRJBHWIHUMBLCN-ZUZCIYMTSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	551
Exact Mass	242.141913202
Heavy Atom Count	18
Isomeric SMILES	CC=C1[C@@H]2CC3=C([C@]1(CC(=C2)C)N)C=CC(=O)N3
Monoisotopic Mass	242.141913202
Topological Polar Surface Area	55.1Ų

Custom Q&A

What is the chemical name of (-)-HUPERZINE A?

The chemical name of (-)-HUPERZINE A is (-)-SELAGINE.

What is the molecular formula of (-)-HUPERZINE A?

The molecular formula of (-)-HUPERZINE A is C15H18N2O.

What is the molecular weight of (-)-HUPERZINE A?

The molecular weight of (-)-HUPERZINE A is 242.32.

What is the melting point of (-)-HUPERZINE A?

The melting point of (-)-HUPERZINE A is 224-6°C.

Where has (-)-HUPERZINE A been isolated from?

(-)-HUPERZINE A has been isolated from L. selago.

What is the specific rotation of (-)-HUPERZINE A?

The specific rotation of (-)-HUPERZINE A is [α]25D - 99° (MeOH).

How was the structure of (-)-HUPERZINE A determined?

The structure of (-)-HUPERZINE A was determined from spectroscopic evidence and comparison with other Lycopodium bases.

What is the other name for (-)-HUPERZINE A?

Another name for (-)-HUPERZINE A is HUPERZIA SERRATA.

※ Please kindly note that our products are for research use only.