Sempervirine nitrate

Catalog Number	ACM17994159
CAS Number	17994-15-9
IUPAC Name	16,17,18,19-Tetrahydro-3H-yohimban-13-ium;nitrate
Molecular Weight	335.40
Molecular Formula	C19H17N3O3
Canonical SMILES	C1CCC2=C[N+]3=C(C=C2C1)C4=C(C=C3)C5=CC=CC=C5N4.[N+](=O)([O-])[O-]
InChI	InChI=1S/C19H16N2.NO3/c1-2-6-14-12-21-10-9-16-15-7-3-4-8-17(15)20-19(16)18(21)11-13(14)5-1;2-1(3)4/h3-4,7-12H,1-2,5-6H2;/q;-1/p+1
InChI Key	NPMOCMWCFIQGMK-UHFFFAOYSA-O
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	414
Exact Mass	335.12699141
Heavy Atom Count	25
Monoisotopic Mass	335.12699141
Topological Polar Surface Area	82.8Ų

Custom Q&A

What is the chemical name of the compound referred to as Sempervirine nitrate?

The chemical name of the compound referred to as Sempervirine nitrate is 1,2,3,4-tetrahydroisoquinolino[3,2-a]$b-carboline.

What is the CAS number for Sempervirine nitrate?

The CAS number for Sempervirine nitrate is 549-92-8.

What is the molecular formula of Sempervirine nitrate?

The molecular formula of Sempervirine nitrate is C19H13N3O3.

What is the molecular weight of Sempervirine nitrate?

The molecular weight of Sempervirine nitrate is 331.32.

What are the product categories that Sempervirine nitrate falls under?

Sempervirine nitrate falls under the category of alkaloids.

What is the melting point of Sempervirine nitrate?

The melting point of Sempervirine nitrate is 271°C.

What are the risk statements associated with Sempervirine nitrate?

The risk statements associated with Sempervirine nitrate are 23/24/25.

What safety statements should be followed when handling Sempervirine nitrate?

The safety statements that should be followed when handling Sempervirine nitrate are 22-36/37/39.

What is the definition of Sempervirine according to ChEBI?

Sempervirine is defined as a member of beta-carbolines according to ChEBI.

What are some synonyms for Sempervirine nitrate?

Some synonyms for Sempervirine nitrate include sempervirine and SEMPERVIRINE NITRATE WITH HPLC.

※ Please kindly note that our products are for research use only.