Senampelin B

Catalog Number	ACM62860520
CAS Number	62860-52-0
Synonyms	Senampeline B
Molecular Weight	473.5
InChI	InChI=1S/C25H31NO8/c1-7-15(4)23(28)31-13-18(9-3)25(30)32-14-19-10-11-26-21(33-17(6)27)12-20(22(19)26)34-24(29)16(5)8-2/h7-11,20-21H,12-14H2,1-6H3/b15-7+,16-8+,18-9+/t20-,21+/m1/s1
InChI Key	DYLUSUNCJYDAKT-IFWBSMHISA-N
Purity	95%+
Complexity	887
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	473.20496695
Heavy Atom Count	34
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	0
Isomeric SMILES	C/C=C(\C)/C(=O)OC/C(=C\C)/C(=O)OCC1=C2[C@@H](C[C@@H](N2C=C1)OC(=O)C)OC(=O)/C(=C/C)/C
Monoisotopic Mass	473.20496695
PhysicalState	Powder
Rotatable Bond Count	13
Topological Polar Surface Area	110 Ų

Custom Q&A

What is the chemical name of Senampeline B?

The chemical name of Senampeline B is 2-Butenoic acid, 2-[[[(2E)-2-methyl-1-oxo-2-buten-1-yl]oxy]methyl]-, [(1R,3S)-3-(acetyloxy)-2,3-dihydro-1-[[(2E)-2-methyl-1-oxo-2-buten-1-yl]oxy]-1H-pyrrolizin-7-yl]methyl ester, (2E)-rel-

What is the CAS number of Senampeline B?

The CAS number of Senampeline B is 62860-52-0.

What is the molecular formula of Senampeline B?

The molecular formula of Senampeline B is C25H31NO8.

What is the molecular weight of Senampeline B?

The molecular weight of Senampeline B is 473.52.

What is the physical appearance of Senampeline B?

Senampeline B is a colourless oil.

In what plant extract can Senampeline B be found?

Senampeline B can be found in the extract of Senecio cissampelinurn.

Is Senampeline B a synthetic compound or naturally occurring?

Senampeline B is a naturally occurring compound.

What is the synonym for Senampeline B?

The synonyms for Senampeline B are Senampelin B and Senampeline B.

※ Please kindly note that our products are for research use only.