Senampelin C

Catalog Number	ACM62841116
CAS Number	62841-11-6
Synonyms	Senampeline C
Molecular Weight	473.5
InChI	InChI=1S/C25H31NO8/c1-7-16(5)24(29)34-20-12-21(33-17(6)27)26-10-9-19(23(20)26)14-32-25(30)18(8-2)13-31-22(28)11-15(3)4/h7-11,20-21H,12-14H2,1-6H3/b16-7+,18-8+/t20-,21+/m1/s1
InChI Key	DZBWFFPQOFEYIE-LSKSLASESA-N
Purity	95%+
Complexity	883
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	473.20496695
Heavy Atom Count	34
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	0
Isomeric SMILES	C/C=C(\C)/C(=O)O[C@@H]1C[C@@H](N2C1=C(C=C2)COC(=O)/C(=C/C)/COC(=O)C=C(C)C)OC(=O)C
Monoisotopic Mass	473.20496695
PhysicalState	Powder
Rotatable Bond Count	13
Topological Polar Surface Area	110 Ų

Custom Q&A

What is the product name of the compound with CAS number 62841-11-6?

The product name is Senampeline C.

What are some synonyms for Senampeline C?

Some synonyms for Senampeline C are Senampelin C, Senampeline C, and 2-Butenoic acid.

What is the chemical formula of Senampeline C?

The chemical formula of Senampeline C is C25H31NO8.

What is the molecular weight of Senampeline C?

The molecular weight of Senampeline C is 473.52 g/mol.

Where is Senampeline C naturally occurring?

Senampeline C is naturally occurring in Senecio cissarnpelinurn.

How is Senampeline C described in terms of physical properties?

Senampeline C is described as a colourless oil.

What is the chemical structure of Senampeline C?

The chemical structure of Senampeline C is a carbonyl compound.

What is the source of Senampeline C?

Senampeline C is sourced from Senecio cissarnpelinurn.

What is the significance of the compound Senampeline C?

Senampeline C is a pyrrolizidine alkaloid that has been isolated from Senecio cissarnpelinurn.

What are some potential uses of Senampeline C?

Some potential uses of Senampeline C include its applications in various fields such as pharmaceuticals, research, and chemical synthesis.

※ Please kindly note that our products are for research use only.