Senecionine N-oxide

Catalog Number	ACM13268672-1
CAS Number	13268-67-2
Structure
Description	Senecionine N-oxide is a natural product that has been shown to have strong cytotoxic effects on cultured liver cells. It is a metabolite of retrorsine and senecionine, which are quinolizidine alkaloids found in plants of the genus Senecio. The presence of the hydroxyl group in senecionine N-oxide makes it more reactive than its parent compounds. This leads to metabolic changes, including an increase in metabolic rate and dose-dependent effects. Senecionine N-oxide also has a high molecular weight, which makes it difficult to measure using analytical methods such as HPLC or GCMS. To overcome this challenge, researchers use sample preparation techniques like thin layer chromatography (TLC) or liquid chromatography (LC). Tissue culture experiments have shown that senecionine N-oxide has biological properties similar to retrorsine and can induce cell death by inhibiting DNA synthesis.
Molecular Weight	351.39 g/mol
Molecular Formula	C18H25NO6
Canonical SMILES	C/C=C\1/C[C@H]([C@@](C(=O)OCC2=CC[N+]3([C@H]2[C@@H](CC3)OC1=O)[O-])(C)O)C
MDL Number	MFCD01750097

Custom Q&A

What is the chemical formula for senecionine N-oxide?

The chemical formula for senecionine N-oxide is C18H25NO6.

What is the molecular weight of senecionine N-oxide?

The molecular weight of senecionine N-oxide is 351.39 g/mol.

What is the predicted pka of senecionine N-oxide?

The predicted pka of senecionine N-oxide is 12.77.

What is the CAS number for senecionine N-oxide?

The CAS number for senecionine N-oxide is 13268-67-2.

What is the hazard class of senecionine N-oxide?

The hazard class of senecionine N-oxide is 6.1(a).

What is the primary usage of senecionine N-oxide?

Senecionine N-oxide is the major pyrrolizidine alkaloid in Senecio vulgaris and is used as an antiproliferative agent for tumor growth.

What is the suspected effect of senecionine N-oxide on rats?

Senecionine N-oxide is suspected to be an antifertility agent in rats.

What is the relationship between senecionine N-oxide and senecionine?

Senecionine N-oxide is functionally related to senecionine, as it is derived from it.

What is the packing group of senecionine N-oxide?

The packing group of senecionine N-oxide is II.

What is the basic structure of senecionine N-oxide?

Senecionine N-oxide is a tertiary amine oxide with a [1,6] dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione structure.

※ Please kindly note that our products are for research use only.