Sericine hydrochlride

Catalog Number	ACM520558
CAS Number	520-55-8
Synonyms	Spectabiline
Molecular Weight	367.4
InChI	InChI=1S/C18H25NO7/c1-10-15(21)25-13-6-8-19-7-5-12(14(13)19)9-24-16(22)17(3,23)18(10,4)26-11(2)20/h5,10,13-14,23H,6-9H2,1-4H3/t10-,13+,14+,17-,18-/m0/s1
InChI Key	ZVBPCOQJPAOXMI-AGMGMWSQSA-N
Purity	95%+
Complexity	675
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	367.16310214
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H]1C(=O)O[C@@H]2CCN3[C@@H]2C(=CC3)COC(=O)[C@]([C@@]1(C)OC(=O)C)(C)O
Monoisotopic Mass	367.16310214
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	102 Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 520-55-8?

The product name is Sericine hydrochloride.

What are some synonyms for Sericine hydrochloride?

Some synonyms for Sericine hydrochloride are Spectabiline hydrochloride and Spectabiline.

What is the molecular formula of Sericine hydrochloride?

The molecular formula of Sericine hydrochloride is C18H25NO7.

What is the molecular weight of Sericine hydrochloride?

The molecular weight of Sericine hydrochloride is 367.39 g/mol.

What is the predicted boiling point of Sericine hydrochloride?

The predicted boiling point of Sericine hydrochloride is 557.2±50.0 °C.

What is the predicted density of Sericine hydrochloride?

The predicted density of Sericine hydrochloride is 1.32±0.1 g/cm3.

What is the predicted pKa value of Sericine hydrochloride?

The predicted pKa value of Sericine hydrochloride is 11.93±0.60.

Where can Sericine hydrochloride be found?

Sericine hydrochloride is an alkaloid found in Ravenia spectabilis (Syn. Lemonia spectabilis).

What is the melting point of the monohydrate form of Sericine hydrochloride?

The melting point of the monohydrate form of Sericine hydrochloride is 98-9°C.

How can the structure of Sericine hydrochloride be determined?

The structure of Sericine hydrochloride can be derived from spectroscopic data, particularly the fragmentation pattern of the mass spectrum.

※ Please kindly note that our products are for research use only.