Serpentine

Catalog Number	ACM18786248-1
CAS Number	18786-24-8
Structure
Synonyms	3,4,5,6-Tetradehydroajmalicine
Molecular Weight	349.4
InChI	InChI=1S/C21H20N2O3/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2/h3-8,11-12,15-16H,9-10H2,1-2H3/p+1/t12-,15-,16+/m0/s1
InChI Key	WYTGDNHDOZPMIW-VBNZEHGJSA-O
Purity	95%+
Complexity	606
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	349.15521754
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H]1[C@H]2C[N+]3=C(C[C@@H]2C(=CO1)C(=O)OC)C4=C(C=C3)C5=CC=CC=C5N4
Monoisotopic Mass	349.15521754
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	55.2 Ų

Custom Q&A

What is the chemical formula of serpentine?

The chemical formula of serpentine is CaH8MgO4Si.

What is the melting point of serpentine?

The melting point of serpentine is 1490 °C.

What are some synonyms for serpentine?

Some synonyms for serpentine are Monticellite and CaMg(SiO4).

How is serpentine used in agriculture?

Serpentine is used in agriculture as a mineral consisting of magnesium silicate with a green and white color and mottled appearance, resembling a snake's skin.

How is serpentine formed?

Serpentine is formed through the metamorphic alteration of ultrabasic rocks rich in olivine, pyroxene, and amphibole.

What are the different forms of serpentine?

Serpentine occurs in two main forms: chrysotile, which is fibrous and the chief source of asbestos, and antigorite, which occurs as platy masses.

What is serpentinite?

Serpentinite is a rock consisting mainly of serpentine, used as an ornamental stone.

What is the density of serpentine?

The density of serpentine is 3.15 g/cm3.

What is the molecular weight of serpentine?

The molecular weight of serpentine is 164.53.

How is serpentine isolated from Rauwolfia serpentina Benth?

Serpentine is isolated from Rauwolfia serpentina Benth and forms yellow plates from MeOH or EtOH.

※ Please kindly note that our products are for research use only.