Sodium camptothecin

Catalog Number	ACM25387671
CAS Number	25387-67-1
Structure
Synonyms	21,22-Secocamptothecin-21-oicacid,monosodiumsalt
IUPAC Name	sodium (2R)-2-hydroxy-2-[8-(hydroxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]butanoate
Molecular Weight	388.3
Molecular Formula	C20H17N2NaO5
InChI	InChI=1S/C20H18N2O5.Na/c1-2-20(27,19(25)26)14-8-16-17-12(9-22(16)18(24)13(14)10-23)7-11-5-3-4-6-15(11)21-17;/h3-8,23,27H,2,9-10H2,1H3,(H,25,26);/q;+1/p-1/t20-;/m0./s1
InChI Key	HPSUBMDJBRNXKK-BDQAORGHSA-M
Boiling Point	777.3ºC at 760 mmHg
Flash Point	423.9ºC
Purity	96%
Complexity	736
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	1
Exact Mass	388.10351593
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC[C@](C1=C(C(=O)N2CC3=CC4=CC=CC=C4N=C3C2=C1)CO)(C(=O)[O-])O.[Na+]
Monoisotopic Mass	388.10351593
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	114 Ų

Custom Q&A

What is the chemical name of the compound sodium camptothecin?

The chemical name of the compound sodium camptothecin is 20(s)-camptothecin sodium salt.

What is the CAS number of sodium camptothecin?

The CAS number of sodium camptothecin is 25387-67-1.

What is the molecular formula of sodium camptothecin?

The molecular formula of sodium camptothecin is C20H17N2NaO5.

What is the molecular weight of sodium camptothecin?

The molecular weight of sodium camptothecin is 388.35 g/mol.

How should sodium camptothecin be stored?

Sodium camptothecin should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the usage of sodium camptothecin?

Sodium camptothecin is the salt form of Camptothecin.

What are some synonyms of sodium camptothecin?

Some synonyms of sodium camptothecin include camptothecin sodium, camptothecine sodium, 21,22-secocamptothecin-21-oic acid, monosodium salt, and 20(S)-camptothecin sodium salt.

What is the chemical structure of sodium camptothecin?

The chemical structure of sodium camptothecin is (αS)-α-Ethyl-9,11-dihydro-α-hydroxy-8-(hydroxymethyl)-9-oxoindolizino[1,2-b]quinoline-7-acetic acid sodium salt.

Does sodium camptothecin require special storage conditions?

Yes, sodium camptothecin should be stored under inert gas at 2-8°C.

Is sodium camptothecin a natural compound or a synthetic compound?

Sodium camptothecin is a salt form of a natural compound called Camptothecin.

※ Please kindly note that our products are for research use only.