Solanidine

Catalog Number	ACM80784
CAS Number	80-78-4
Synonyms	22R,25S-Solanidanine
Molecular Weight	397.6
InChI	InChI=1S/C27H43NO/c1-16-5-8-23-17(2)25-24(28(23)15-16)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h6,16-17,19-25,29H,5,7-15H2,1-4H3/t16-,17+,19-,20+,21-,22-,23+,24-,25-,26-,27-/m0/s1
InChI Key	JVKYZPBMZPJNAJ-OQFNDJACSA-N
Melting Point	212-214 °C
Purity	90%+
Complexity	715
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	11
Exact Mass	397.334464995
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H]1CC[C@@H]2[C@H]([C@H]3[C@@H](N2C1)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O)C)C)C
Monoisotopic Mass	397.334464995
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	23.5 Ų

Custom Q&A

What are some synonyms for solanidine?

Solatubine, Solanidine HCL, 22R,25S-Solanidanine, 3-beta-Solanid-5-en-3-ol, etc.

What is the molecular formula for solanidine?

C27H43NO

What is the molecular weight of solanidine?

397.64

At what temperature does solanidine melt?

212-214°C

What is the color of solanidine?

White to Off-White

What is the storage temperature recommended for solanidine?

2-8°C

What are the hazard codes associated with solanidine?

T+, Xn

What is the major use of solanidine?

It has been shown to display mutagenic properties in the liver and is stored in the body for prolonged periods of time.

How does solanidine crystallize?

From CHCl3/MeOH, aqueous EtOH, or aqueous MeOH as needles.

How can solanidine be purified?

By crystallization from CHCl3/MeOH, TLC on Al2O3 plates, and crystallization of hydrochloride from aqueous EtOH.

※ Please kindly note that our products are for research use only.