Songorine

Catalog Number	ACM509240
CAS Number	509-24-0
Synonyms	Bullatine G
Molecular Weight	357.5
InChI	InChI=1S/C22H31NO3/c1-4-23-10-20(3)6-5-17(25)22-15(20)7-13(18(22)23)21-9-12(11(2)19(21)26)14(24)8-16(21)22/h12-13,15-19,25-26H,2,4-10H2,1,3H3/t12-,13+,15-,16-,17+,18-,19-,20+,21+,22+/m1/s1
InChI Key	CBOSLVQFGANWTL-DVPYZRQCSA-N
Melting Point	201-203 °C
Purity	95%+
Complexity	735
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	10
Exact Mass	357.23039385
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2C[C@@H]([C@H]31)[C@]56[C@H]4CC(=O)[C@H](C5)C(=C)[C@H]6O)O)C
Monoisotopic Mass	357.23039385
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	60.8 Ų

Custom Q&A

What is the chemical formula of SONGORINE?

The chemical formula of SONGORINE is C22H31NO3.

What is the molecular weight of SONGORINE?

The molecular weight of SONGORINE is 357.49.

At what temperature does SONGORINE melt?

SONGORINE melts at 212°C.

What is the biological source of SONGORINE?

SONGORINE is isolated from Aconitum soongaricum.

What is the specific rotation of SONGORINE?

SONGORINE is strongly laevorotatory with [α]D - 139.89°.

What are some known crystalline salts and derivatives of SONGORINE?

Some known crystalline salts and derivatives include hydrochloride, hydrobromide, nitrate, perchlorate, methiodide, and semicarbazone.

What is the dihydro derivative of SONGORINE obtained through catalytic hydrogenation?

The dihydro derivative of SONGORINE is obtained through catalytic hydrogenation over PtO2.

What biological activities have been associated with SONGORINE?

SONGORINE has been associated with anti-cancer, anti-depressant, anti-nociceptive, anti-inflammatory, anti-pyretic, anti-platelet, anti-oxidant, and anti-bacterial properties.

Who conducted early studies on the chemical and biological properties of SONGORINE?

Early studies on the chemical and biological properties of SONGORINE were conducted by Yunusov, Wiesner, Ito, Valenta, Sugasawa, and Okamoto.

What is the association of songorine with napelline?

Songorine is a C20 diterpenoid alkaloid and 12-keto analog of napelline.

※ Please kindly note that our products are for research use only.