Sophocarpine

Catalog Number	ACM145572447-1
CAS Number	145572-44-7
Structure
Synonyms	13,14-Didehydromatridin-15-one
IUPAC Name	(1R,2R,9S,17S)-7,13-Diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one
Molecular Weight	246.35
Molecular Formula	C15H22N2O
Canonical SMILES	C1CC2CN3C(CC=CC3=O)C4C2N(C1)CCC4
InChI	InChI=1S/C15H22N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h1,7,11-13,15H,2-6,8-10H2/t11-,12+,13+,15-/m0/s1
InChI Key	AAGFPTSOPGCENQ-JLNYLFASSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	392
Exact Mass	246.173213330
Heavy Atom Count	18
Isomeric SMILES	C1C[C@H]2CN3[C@H](CC=CC3=O)[C@@H]4[C@H]2N(C1)CCC4
Monoisotopic Mass	246.173213330
Topological Polar Surface Area	23.6Ų

Custom Q&A

What is another name for Sophocarpine?

Sophocarpine is also known as SOPHOCARPINE(RG).

What is the CAS number for Sophocarpine?

The CAS number for Sophocarpine is 6483-15-4.

What is the molecular formula of Sophocarpine?

The molecular formula of Sophocarpine is C15H22N2O.

What is the melting point of Sophocarpine?

The melting point of Sophocarpine is 54-55°C.

What is the boiling point of Sophocarpine?

The boiling point of Sophocarpine is 170-210°C at 5 Torr.

What is the density of Sophocarpine?

The density of Sophocarpine is 1.19±0.1 g/cm3.

In what form does Sophocarpine occur?

Sophocarpine occurs as a crystalline solid.

What is the pka of Sophocarpine?

The pka of Sophocarpine is 9.59±0.20.

What is one of the uses of Sophocarpine?

Sophocarpine is used as an intermediate in the synthesis of (+)-Matrine-d3, an alkaloid compound with various pharmacological effects.

What positive pharmacological effects are maintained by compounds derived from Sophocarpine?

Compounds derived from Sophocarpine, such as (+)-Matrine, maintain anti-inflammatory, anti-cancer, and other positive pharmacological effects.

※ Please kindly note that our products are for research use only.