Spartioidine

Catalog Number	ACM520592
CAS Number	520-59-2
Synonyms	(15E)-13,19-Didehydro-12β-hydroxysenecionan-11,16-dione
IUPAC Name	Spartioidine
Molecular Weight	333.4
Molecular Formula	C18H23NO5
InChI	InChI=1S/C18H23NO5/c1-4-12-9-11(2)18(3,22)17(21)23-10-13-5-7-19-8-6-14(15(13)19)24-16(12)20/h4-5,14-15,22H,2,6-10H2,1,3H3/b12-4+/t14-,15-,18+/m1/s1
InChI Key	FCEVNJIUIMLVML-DVZMFYIRSA-N
Purity	95%+
Complexity	650
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	333.15762283
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C/1\CC(=C)[C@](C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC1=O)(C)O
Monoisotopic Mass	333.15762283
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	76.1 Ų

Custom Q&A

What is the chemical name of Spartioidine?

The chemical name of Spartioidine is (15E)-13,19-Didehydro-12β-hydroxysenecionan-11,16-dione.

What are the synonyms of Spartioidine?

The synonyms of Spartioidine are Spartioidine and [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, among others.

What is the CAS number of Spartioidine?

The CAS number of Spartioidine is 520-59-2.

What is the molecular formula of Spartioidine?

The molecular formula of Spartioidine is C18H23NO5.

What is the molecular weight of Spartioidine?

The molecular weight of Spartioidine is 333.38.

What is the structure of Spartioidine?

The structure of Spartioidine can be represented as (3E,6S,14aR,14bR)-3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-methyl-5-methylene-.

What type of compound is Spartioidine?

Spartioidine is a natural product and a bioactive compound.

What is the significance of Spartioidine?

Spartioidine has been studied for its potential pharmacological activities, such as anticancer properties.

How is Spartioidine obtained?

Spartioidine can be isolated from certain plant species or synthesized in the laboratory.

Can Spartioidine be used in medicinal applications?

Yes, Spartioidine has shown promise in medicinal applications, particularly in the field of cancer research.

※ Please kindly note that our products are for research use only.