Spiracine

Catalog Number	ACM77156242
CAS Number	77156-24-2
Molecular Weight	485.5
InChI	InChI=1S/C23H35NO10/c1-6-21(5,29)23(31)17(25)18(26)33-13(4)22(30,12(2)3)19(27)32-11-14-7-9-24-10-8-15(16(14)24)34-20(23)28/h7,12-13,15-17,25,29-31H,6,8-11H2,1-5H3/t13,15-,16-,17,21,22,23/m1/s1
InChI Key	ZMTPMWQLYFVWSP-YHWJFGDTSA-N
Purity	95%+
Complexity	874
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	485.22609631
Heavy Atom Count	34
Hydrogen Bond Acceptor Count	11
Hydrogen Bond Donor Count	4
Isomeric SMILES	CCC(C)(C1(C(C(=O)OC(C(C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC1=O)(C(C)C)O)C)O)O)O
Monoisotopic Mass	485.22609631
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	163 Ų

Custom Q&A

What is the product name of Spiracine?

The product name of Spiracine is Spiracine.

What are some synonyms for Spiracine?

Some synonyms for Spiracine are 7H-[1,5,10]Trioxacyclotetradecino[7,8,9-gh]pyrrolizine-2,5,9(8H)-trione and (16aR,16bR)-.

What is the CAS number of Spiracine?

The CAS number of Spiracine is 77156-24-2.

What is the molecular formula of Spiracine?

The molecular formula of Spiracine is C23H35NO10.

What is the molecular weight of Spiracine?

The molecular weight of Spiracine is 485.52.

Where does the pyrrolizidine alkaloid spiracine occur?

The pyrrolizidine alkaloid spiracine occurs in Parsonia spiralis Wall.

What is the chemical structure of Spiracine?

The chemical structure of Spiracine is 3,4,11,13,15,16,16a,16b-octahydro-3,4,8-trihydroxy-3-(1-hydroxy-1-methylpropyl)-7-methyl-8-(1-methylethyl)-.

What is the stereochemistry of Spiracine?

The stereochemistry of Spiracine is (16aR,16bR)-.

How is Spiracine commonly used?

Spiracine is commonly used as a pyrrolizidine alkaloid found in Parsonia spiralis Wall.

What is the significance of Spiracine in terms of its properties or applications?

Spiracine is a pyrrolizidine alkaloid that is naturally occurring and has properties that have been studied for various purposes.

※ Please kindly note that our products are for research use only.