Spiraline

Catalog Number	ACM77156253
CAS Number	77156-25-3
Synonyms	(16R)-16-Hydroxyparsonsine
Molecular Weight	455.5
InChI	InChI=1S/C22H33NO9/c1-11(2)21(28)13(5)31-18(25)17(24)22(29,12(3)4)20(27)32-15-7-9-23-8-6-14(16(15)23)10-30-19(21)26/h6,11-13,15-17,24,28-29H,7-10H2,1-5H3/t13-,15-,16-,17+,21+,22-/m1/s1
InChI Key	SHUMEODPCRJUBC-JLWRCLLRSA-N
Purity	95%+
Complexity	809
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	455.21553163
Heavy Atom Count	32
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	3
Isomeric SMILES	C[C@@H]1[C@](C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC(=O)[C@]([C@H](C(=O)O1)O)(C(C)C)O)(C(C)C)O
Monoisotopic Mass	455.21553163
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	143 Ų

Custom Q&A

What is the typical appearance of SPIRALINE in its crystal form?

SPIRALINE forms colorless crystals.

What are some synonyms of SPIRALINE?

Some synonyms of SPIRALINE include (16R)-16-Hydroxyparsonsine and 7H-[1,5,10]Trioxacyclotetradecino[7,8,9-gh]pyrrolizine-2,5,9(8H)-trione.

What is the CAS number of SPIRALINE?

The CAS number of SPIRALINE is 77156-25-3.

What is the molecular formula of SPIRALINE?

The molecular formula of SPIRALINE is C22H33NO9.

What is the molecular weight of SPIRALINE?

The molecular weight of SPIRALINE is 455.5.

How does Parsonia spiralis Wall contribute to the occurrence of SPIRALINE?

Parsonia spiralis Wall yields this pyrrolizidine base which forms colorless crystals from ethanol.

What is the chemical structure of SPIRALINE?

The chemical structure of SPIRALINE is 7H-[1,5,10]Trioxacyclotetradecino[7,8,9-gh]pyrrolizine-2,5,9(8H)-trione.

What is the stereochemistry of SPIRALINE?

The stereochemistry of SPIRALINE is (16aR,16bR).

How can SPIRALINE be obtained from Parsonia spiralis Wall?

SPIRALINE can be obtained by extracting it from Parsonia spiralis Wall and then crystallizing it from ethanol.

※ Please kindly note that our products are for research use only.