Stepharine

Stepharine

Inquiry
Catalog Number ACM2810211
CAS Number 2810-21-1
Synonyms (8'aR)-2',3',8',8'a-Tetrahydro-5',6'-dimethoxyspiro[2,5-cyclohexadiene-1,7'(1'H)-cyclopenta[ij]isoquinoline]-4-one
Molecular Weight 297.3
InChI InChI=1S/C18H19NO3/c1-21-14-9-11-5-8-19-13-10-18(6-3-12(20)4-7-18)16(15(11)13)17(14)22-2/h3-4,6-7,9,13,19H,5,8,10H2,1-2H3
InChI Key OGJKMZVUJJYWKO-UHFFFAOYSA-N
Melting Point 179-181 °C
Purity 95%+
Complexity 510
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 297.13649347
Heavy Atom Count 22
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 1
Monoisotopic Mass 297.13649347
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 47.6 Ų
Custom Q&A

What is the chemical name of the compound referred to as Stepharine?

(8'aR)-2',3',8',8'a-Tetrahydro-5',6'-dimethoxyspiro[2,5-cyclohexadiene-1,7'(1'H)-cyclopenta[ij]isoquinoline]-4-one.

What are some synonyms for Stepharine?

(+)-Stepharine, Stepharine.

What is the CAS number for Stepharine?

2810-21-1.

What is the molecular formula of Stepharine?

C18H19NO3.

What is the molecular weight of Stepharine?

297.34836 g/mol.

What is the predicted melting point of Stepharine?

179-181 °C.

What is the predicted boiling point of Stepharine?

487.1±45.0 °C.

What is the predicted density of Stepharine?

1.27±0.1 g/cm3.

What is the storage recommendation for Stepharine?

Store at 4°C and protect from light.

What is the chemical description of Stepharine?

A spiroisoquinoline alkaloid from Stephania glabra, with specific optical rotation and certain functional groups.

※ Please kindly note that our products are for research use only.