Strobamine

Catalog Number	ACM75656916
CAS Number	75656-91-6
Molecular Weight	269.34
InChI	InChI=1S/C17H19NO2/c1-18-12-7-8-13(18)17-14(19)10-15(20-16(17)9-12)11-5-3-2-4-6-11/h2-6,12-13,15H,7-10H2,1H3/t12-,13+,15+/m1/s1
InChI Key	SMCUGCCLJBVSAQ-IPYPFGDCSA-N
Purity	95%+
Complexity	450
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	269.141578849
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1[C@@H]2CC[C@H]1C3=C(C2)O[C@@H](CC3=O)C4=CC=CC=C4
Monoisotopic Mass	269.141578849
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the chemical formula of Strobamine?

The chemical formula of Strobamine is C17H19NO2.

What is the molecular weight of Strobamine?

The molecular weight of Strobamine is 269.34 g/mol.

What is the CAS number of Strobamine?

The CAS number of Strobamine is 75656-91-6.

What are the synonyms for Strobamine?

The synonyms for Strobamine include Cyclohepta[b]pyran-5,8-imin-4(5H)-one, 2,3,6,7,8,9-hexahydro-10-methyl-2-phenyl-, (2S,5S,8R)-.

What is the predicted boiling point of Strobamine?

The predicted boiling point of Strobamine is 423.9±45.0 °C.

What is the predicted density of Strobamine?

The predicted density of Strobamine is 1.23±0.1 g/cm3.

What is the predicted pka of Strobamine?

The predicted pka of Strobamine is 6.87±0.40.

Where does Strobamine occur naturally?

Strobamine is one of two closely related alkaloids recently isolated from Knightia strobilina.

What is the specific rotation of Strobamine?

Strobamine is dextrorotatory, with a specific rotation of [α]D +36° (CRCI3).

※ Please kindly note that our products are for research use only.