Stylopine

Stylopine

Inquiry
Catalog Number ACM4312327-1
CAS Number 4312-32-7 / 7461-02-1
Synonyms Tetrahydrocoptisine
Molecular Weight 323.3
InChI InChI=1S/C19H17NO4/c1-2-16-19(24-10-21-16)14-8-20-4-3-12-6-17-18(23-9-22-17)7-13(12)15(20)5-11(1)14/h1-2,6-7,15H,3-5,8-10H2
InChI Key UXYJCYXWJGAKQY-UHFFFAOYSA-N
Melting Point 221-222 °C
Purity 90%+
Complexity 502
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 323.11575802
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 323.11575802
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 40.2 Ų
Custom Q&A

What is the product name of the compound with the CAS number 4312-32-7?

The product name is (-)-STYLOPINE.

What is the molecular formula of (-)-STYLOPINE?

The molecular formula is C19H17NO4.

What is the molecular weight of (-)-STYLOPINE?

The molecular weight is 323.34.

What is the melting point of (-)-STYLOPINE?

The melting point is 221-222℃.

What is the boiling point of (-)-STYLOPINE?

The predicted boiling point is 466.6±34.0°C.

In what type of atmosphere should (-)-STYLOPINE be stored?

It should be stored in an inert atmosphere at room temperature.

What is the solubility of (-)-STYLOPINE in dimethylformamide (DMF)?

The maximum concentration in DMF is 1.0 mg/mL or 3.09 mM.

What is the form of (-)-STYLOPINE?

It is in a solid form.

What is the pKa of (-)-STYLOPINE?

The predicted pKa is 6.53±0.20.

Where is dl-Stylopine isolated from?

dl-Stylopine is isolated from the whole plant of Argemone mexicana.

※ Please kindly note that our products are for research use only.