Swietenidin B

Catalog Number	ACM2721564
CAS Number	2721-56-4
Structure
Synonyms	3,4-Dimethoxy-2-quinolinol
Molecular Weight	205.21
InChI	InChI=1S/C11H11NO3/c1-14-9-7-5-3-4-6-8(7)12-11(13)10(9)15-2/h3-6H,1-2H3,(H,12,13)
InChI Key	SZUBEJQEEOURQH-UHFFFAOYSA-N
Melting Point	182 °C
Purity	95%+
Complexity	298
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	205.07389321
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	205.07389321
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	47.6 Ų

Custom Q&A

What is the chemical formula of Swietenidin B?

The chemical formula of Swietenidin B is C11H11NO3.

What is the molecular weight of Swietenidin B?

The molecular weight of Swietenidin B is 205.21.

What is the melting point of Swietenidin B?

The melting point of Swietenidin B is 182 °C.

What is the boiling point of Swietenidin B?

The predicted boiling point of Swietenidin B is 464.1±45.0 °C.

What is the density of Swietenidin B?

The predicted density of Swietenidin B is 1.25±0.1 g/cm3.

What is the pKa value of Swietenidin B?

The predicted pKa value of Swietenidin B is 9.77±0.70.

What is another name for Swietenidin B?

Swietenidin B is also known as 3,4-Dimethoxy-2-quinolinol or 3,4-Dimethoxyquinolin-2(1H)-one.

What is the classification of Swietenidin B in terms of chemical structure?

Swietenidin B is a member of quinolines.

What is the CAS number of Swietenidin B?

The CAS number of Swietenidin B is 2721-56-4.

How is Swietenidin B synthesized?

Swietenidin B can be synthesized as a member of quinolines.

※ Please kindly note that our products are for research use only.