Syneilesine

Catalog Number	ACM55652658
CAS Number	55652-65-8
Synonyms	15,20-Dihydro-12,14α-dihydroxy-4-methyl-4,8-secosenecionan-8,11,16-trione
Molecular Weight	383.4
InChI	InChI=1S/C19H29NO7/c1-5-13-15(21)11(2)19(3,25)18(24)26-10-12-6-8-20(4)9-7-14(16(12)22)27-17(13)23/h6,11,13-15,21,25H,5,7-10H2,1-4H3/b12-6-/t11-,13,14-,15+,19-/m1/s1
InChI Key	GUCAZZVOPNEPFJ-VZXZMQOTSA-N
Melting Point	195 °C
Purity	95%+
Complexity	632
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	383.19440226
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	2
Isomeric SMILES	CCC1[C@H]([C@H]([C@@](C(=O)OC/C/2=C/CN(CC[C@H](C2=O)OC1=O)C)(C)O)C)O
Monoisotopic Mass	383.19440226
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	113 Ų

Custom Q&A

What is the chemical formula of SYNEILESINE?

The chemical formula of SYNEILESINE is C19H29NO7.

What is the molecular weight of SYNEILESINE?

The molecular weight of SYNEILESINE is 383.44.

What is the melting point of SYNEILESINE?

The melting point of SYNEILESINE is 195°C.

What is the predicted boiling point of SYNEILESINE?

The predicted boiling point of SYNEILESINE is 634.1±55.0 °C.

What is the predicted density of SYNEILESINE?

The predicted density of SYNEILESINE is 1.26±0.1 g/cm3.

What is the pka value of SYNEILESINE?

The pka value of SYNEILESINE is 12.56±0.70.

Where does syneilesine occur naturally?

Syneilesine occurs in Syneilensis palrnata.

How is syneilesine purified?

Syneilesine forms colorless needles when purified by recrystallization from light petroleum.

How is the structure of syneilesine established?

The structure of syneilesine is established from chemical and spectroscopic data.

What is the reference for information on syneilesine?

The reference for information on syneilesine is Hikichi, Furuya, Tetrahedron Lett., 3657 (1974).

※ Please kindly note that our products are for research use only.