(-)-Synephrine

Catalog Number	ACM614357
CAS Number	614-35-7
Synonyms	4-[(1R)-1-Hydroxy-2-(methylamino)ethyl]phenol
Molecular Weight	167.2
InChI	InChI=1S/C9H13NO2/c1-10-6-9(12)7-2-4-8(11)5-3-7/h2-5,9-12H,6H2,1H3/t9-/m0/s1
InChI Key	YRCWQPVGYLYSOX-VIFPVBQESA-N
Melting Point	165 °C
Purity	98%+
Complexity	122
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	167.094628657
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Isomeric SMILES	CNC[C@@H](C1=CC=C(C=C1)O)O
Monoisotopic Mass	167.094628657
PhysicalState	Solid
Rotatable Bond Count	3
Topological Polar Surface Area	52.5 Ų

Custom Q&A

What is the chemical name of (-)-Synephrine?

Benzenemethanol, 4-hydroxy-α-[(methylamino)methyl]-, (αR)

What is the CAS number of (-)-Synephrine?

614-35-7

What is the molecular formula of (-)-Synephrine?

C9H13NO2

What is the molecular weight of (-)-Synephrine?

167.21

What is the melting point of (-)-Synephrine?

165 °C (dec.)

What is the boiling point of (-)-Synephrine?

341.1±27.0 °C (Predicted)

What is the water solubility of (-)-Synephrine?

2 mg/mL (11.96 mM)

What is the safety HS code of (-)-Synephrine?

2922.50.4000

What is the toxicity of (-)-Synephrine?

LDLo subcutaneous in mouse: 700mg/kg

What is one of the uses of R-(-)-p-Synephrine?

It has antidepressant-like activity in murine models.

※ Please kindly note that our products are for research use only.