Synephrine hydrochloride

Catalog Number	ACM5985284
CAS Number	5985-28-4
Structure
Synonyms	1-(4-Hydroxyphenyl)-2-(methylamino)-ethanol hydrochloride
Molecular Weight	203.66
InChI	InChI=1S/C9H13NO2.ClH/c1-10-6-9(12)7-2-4-8(11)5-3-7;/h2-5,9-12H,6H2,1H3;1H
InChI Key	COTCEGYSNTWJQV-UHFFFAOYSA-N
Melting Point	147-150 °C
Purity	95%+
Complexity	122
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	0
Exact Mass	203.0713064
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	4
Monoisotopic Mass	203.0713064
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	52.5 Ų

Custom Q&A

What is the chemical formula for Synephrine hydrochloride?

The chemical formula for Synephrine hydrochloride is C9H14ClNO2.

What is the molecular weight of Synephrine hydrochloride?

The molecular weight of Synephrine hydrochloride is 203.67.

What is the melting point of Synephrine hydrochloride?

The melting point of Synephrine hydrochloride is 147-150°C.

In what form does Synephrine hydrochloride exist?

Synephrine hydrochloride exists in solid form.

What is the color of Synephrine hydrochloride?

The color of Synephrine hydrochloride is off-white to pale beige.

What is the primary usage of Synephrine hydrochloride?

Synephrine hydrochloride is used as a α-adrenergic receptor agonist and vasoconstrictor.

How does Synephrine hydrochloride affect adrenergic receptors?

Synephrine hydrochloride binds to α1A-, α2A-, and α2C-adrenergic receptors.

What kind of activities does Synephrine hydrochloride exhibit in isolated rabbit aortic rings?

Synephrine hydrochloride induces contractions in isolated rabbit aortic rings.

How does Synephrine hydrochloride affect lipolysis in adipocytes?

Synephrine hydrochloride induces lipolysis in isolated rat and human adipocytes.

How does Synephrine hydrochloride affect glucose consumption in muscle cells?

Synephrine hydrochloride increases insulin-induced glucose consumption in L6 muscle cells.

※ Please kindly note that our products are for research use only.