Syrosingopine

Catalog Number	ACM84366
CAS Number	84-36-6
Structure
Synonyms	Menatensina
Molecular Weight	666.7
Molecular Formula	C35H42N2O11
InChI	InChI=1S/C35H42N2O11/c1-7-46-35(40)48-31-26(42-3)12-18(13-27(31)43-4)33(38)47-28-14-19-17-37-11-10-22-21-9-8-20(41-2)15-24(21)36-30(22)25(37)16-23(19)29(32(28)44-5)34(39)45-6/h8-9,12-13,15,19,23,25,28-29,32,36H,7,10-11,14,16-17H2,1-6H3/t19-,23+,25-,28-,29+,32+/m1/s1
InChI Key	ZCDNRPPFBQDQHR-SSYATKPKSA-N
Purity	95%+
Complexity	1130
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	666.27886016
Heavy Atom Count	48
Hydrogen Bond Acceptor Count	12
Hydrogen Bond Donor Count	1
Isomeric SMILES	CCOC(=O)OC1=C(C=C(C=C1OC)C(=O)O[C@@H]2C[C@@H]3CN4CCC5=C([C@H]4C[C@@H]3[C@@H]([C@H]2OC)C(=O)OC)NC6=C5C=CC(=C6)OC)OC
Monoisotopic Mass	666.27886016
PhysicalState	Solid
Rotatable Bond Count	13
Topological Polar Surface Area	144 Ų

Custom Q&A

What is the chemical formula of Syrosingopine?

The chemical formula of Syrosingopine is C35H42N2O11.

What is the molecular weight of Syrosingopine?

The molecular weight of Syrosingopine is 666.72 g/mol.

What is the melting point of Syrosingopine?

The melting point of Syrosingopine is 175°C.

How soluble is Syrosingopine in chloroform and methanol?

Syrosingopine is slightly soluble in chloroform and methanol.

What is the origin of Syrosingopine?

Syrosingopine was developed by Singoserp, Ciba, US in 1958.

What is the main use of Syrosingopine?

Syrosingopine is a pharmaceutical used to treat hypertension.

What is the manufacturing process of Syrosingopine?

The manufacturing process involves the dissolution of methyl reserpate and Ocarbethoxysyringoyl chloride in pyridine followed by a series of washes and chromatography.

What is the therapeutic function of Syrosingopine?

Syrosingopine acts as an antihypertensive drug.

What is the toxicity level of Syrosingopine in rats?

The LD50 oral dosage of Syrosingopine in rats is greater than 2gm/kg.

What is the main target of Syrosingopine in terms of therapeutic function?

The main targets of Syrosingopine include HCV, antifection, androgen receptor, histone methyltransferase, NF-kB, and Mdm2.

※ Please kindly note that our products are for research use only.