Taberdivarine H

Catalog Number	ACM1662688347
CAS Number	1662688-34-7
Synonyms	Taberdivarine I
Molecular Weight	322.4
InChI	InChI=1S/C20H22N2O2/c1-3-12-11-22(2)9-8-14-13-6-4-5-7-16(13)21-18(14)17(22)10-15(12)19(21)20(23)24/h3-7,15,17,19H,8-11H2,1-2H3/b12-3-/t15-,17-,19+,22/m0/s1
InChI Key	MBYUFXAXLKULGV-SFQLIIISSA-N
Purity	95%+
Complexity	597
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	322.168127949
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	C/C=C\1/C[N+]2(CCC3=C4[C@@H]2C[C@@H]1[C@@H](N4C5=CC=CC=C35)C(=O)[O-])C
Monoisotopic Mass	322.168127949
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	45.1 Ų

Custom Q&A

What is the product name of Taberdivarine H?

The product name of Taberdivarine H is Taberdivarine H.

What are the synonyms for Taberdivarine H?

The synonyms for Taberdivarine H are Taberdivarine H and Taberdivarine I.

What is the CAS number for Taberdivarine H?

The CAS number for Taberdivarine H is 1662688-34-7.

What is the molecular formula of Taberdivarine H?

The molecular formula of Taberdivarine H is C20H23N2O2+.

What is the molecular weight of Taberdivarine H?

The molecular weight of Taberdivarine H is 323.42.

How is Taberdivarine H represented in chemical notation?

Taberdivarine H is represented as C20H23N2O2+ in chemical notation.

What is the significance of the molecular formula of Taberdivarine H?

The molecular formula of Taberdivarine H indicates the specific atoms and their ratios in the compound.

What is the molecular weight used for in the context of Taberdivarine H?

The molecular weight is used to determine the mass of Taberdivarine H relative to the atomic mass unit.

How does knowing the CAS number help identify Taberdivarine H?

The CAS number is a unique identifier assigned to chemicals, helping in the accurate identification of Taberdivarine H among other compounds.

※ Please kindly note that our products are for research use only.