Taberpsychine

Taberpsychine

Inquiry
Catalog Number ACM19452847
CAS Number 19452-84-7
Synonyms (19Z)-Anhydrovobasinediol
Molecular Weight 308.4
InChI InChI=1S/C20H24N2O/c1-3-12-10-22(2)18-8-15-13-6-4-5-7-17(13)21-20(15)19-9-14(12)16(18)11-23-19/h3-7,14,16,18-19,21H,8-11H2,1-2H3
InChI Key HKVAGGQESSDYDU-UHFFFAOYSA-N
Complexity 504
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 308.188863393
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 1
Monoisotopic Mass 308.188863393
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 28.3 Ų
Custom Q&A

What is the chemical name of (19Z)-Anhydrovobasinediol?

The chemical name of (19Z)-Anhydrovobasinediol is 3β,17-Epoxyvobasan.

What is another name for (19Z)-Anhydrovobasinediol?

Another name for (19Z)-Anhydrovobasinediol is Taberpsychine.

What is the CAS number for (19Z)-Anhydrovobasinediol?

The CAS number for (19Z)-Anhydrovobasinediol is 19452-84-7.

What is the molecular formula of (19Z)-Anhydrovobasinediol?

The molecular formula of (19Z)-Anhydrovobasinediol is C20H24N2O.

What is the predicted boiling point of (19Z)-Anhydrovobasinediol?

The predicted boiling point of (19Z)-Anhydrovobasinediol is 490.6±45.0 °C.

In what solvents is (19Z)-Anhydrovobasinediol soluble?

(19Z)-Anhydrovobasinediol is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

How can the alkaloid (19Z)-Anhydrovobasinediol be purified?

The alkaloid (19Z)-Anhydrovobasinediol can be purified by recrystallization from Me2CO followed by sublimation.

What is the melting point of (19Z)-Anhydrovobasinediol?

The melting point of (19Z)-Anhydrovobasinediol is 20So C (dec.).

What is the predicted pKa of (19Z)-Anhydrovobasinediol?

The predicted pKa of (19Z)-Anhydrovobasinediol is 17.39±0.20.

What are the products obtained from the zinc dust distillation of (19Z)-Anhydrovobasinediol?

The products obtained from the zinc dust distillation of (19Z)-Anhydrovobasinediol are 3-ethylpyridine and 3-methyl-5-ethylpyridine.

※ Please kindly note that our products are for research use only.