Taspine

Taspine

Inquiry
Catalog Number ACM602073
CAS Number 602-07-3
Structure
Synonyms 3,8-Dimethoxy-1-[2-(dimethylamino)ethyl][1]benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione
Molecular Weight 369.4
InChI InChI=1S/C20H19NO6/c1-21(2)8-7-10-9-13(25-4)18-16-14(10)20(23)27-17-12(24-3)6-5-11(15(16)17)19(22)26-18/h5-6,9H,7-8H2,1-4H3
InChI Key MTAWKURMWOXCEO-UHFFFAOYSA-N
Melting Point >300 °C
Purity 95%+
Complexity 595
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 369.12123733
Heavy Atom Count 27
Hydrogen Bond Acceptor Count 7
Hydrogen Bond Donor Count 0
Monoisotopic Mass 369.12123733
PhysicalState Powder
Rotatable Bond Count 5
Topological Polar Surface Area 74.3 Ų
Custom Q&A

What is the chemical name of taspine?

The chemical name of taspine is 1-(2-(dimethylamino)ethyl)-3,8-dimethoxychromeno[5,4,3-cde]chromene-5,10-dione.

What are some synonyms for taspine?

Some synonyms for taspine are 3,8-Dimethoxy-1-[2-(dimethylamino)ethyl][1]benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione and Benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione, 1-[2-(dimethylamino)ethyl]-3,8-dimethoxy-.

What is the CAS number for taspine?

The CAS number for taspine is 602-07-3.

What is the molecular formula of taspine?

The molecular formula of taspine is C20H19NO6.

What is the molecular weight of taspine?

The molecular weight of taspine is 369.37.

What is the melting point of taspine?

The melting point of taspine is greater than 300°C.

What is the boiling point of taspine?

The boiling point of taspine is predicted to be 569.6±50.0 °C.

In what form is taspine commonly found?

Taspine is commonly found in solid form.

What is the solubility of taspine?

Taspine is soluble in chloroform.

What are some of the pharmaceutical properties exhibited by taspine?

Taspine shows various pharmaceutical properties such as bacteriostatic, wound healing, cytotoxicity, immunosuppression, acetylcholinesterase inhibition, and inhibition of the activity of tumor angiogenesis.

※ Please kindly note that our products are for research use only.