Tembetarine

Catalog Number	ACM18446736-1
CAS Number	18446-73-6
Structure
Synonyms	(S)-Tembetarine
IUPAC Name	(1S)-1-[(3-Hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-7-ol
Molecular Weight	344.40
Molecular Formula	C20H26NO4
Canonical SMILES	C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)O)O)OC)C
InChI	InChI=1S/C20H25NO4/c1-21(2)8-7-14-11-20(25-4)18(23)12-15(14)16(21)9-13-5-6-19(24-3)17(22)10-13/h5-6,10-12,16H,7-9H2,1-4H3,(H-,22,23)/p+1/t16-/m0/s1
InChI Key	ABSDACFLIMOXJY-INIZCTEOSA-O
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	443
Exact Mass	344.18618331
Heavy Atom Count	25
Isomeric SMILES	C[N+]1(CCC2=CC(=C(C=C2[C@@H]1CC3=CC(=C(C=C3)OC)O)O)OC)C
Monoisotopic Mass	344.18618331
Topological Polar Surface Area	58.9Ų

Custom Q&A

What is the chemical name of tembetarine?

The chemical name of tembetarine is (1S)-1,2,3,4-Tetrahydro-7-hydroxy-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2,2-dimethylisoquinolin-2-ium.

What is the CAS number of tembetarine?

The CAS number of tembetarine is 18446-73-6.

How is tembetarine isolated?

Tembetarine is isolated as the crystalline chloride from the bark of Fagara naranjillo (Griseb.) Engl.

What is the melting point of tembetarine?

The melting point of tembetarine is reported to be 236-7°C.

What is the specific rotation of tembetarine in ethanol?

The specific rotation of tembetarine in ethanol is reported to be +123.3°.

What is the ultraviolet absorption maximum of tembetarine?

Tembetarine has a single absorption maximum at 284 nm in its ultraviolet spectrum.

What is the dimethyl ether of tembetarine identical to?

The dimethyl ether of tembetarine is identical to Laudanosine methyl ether.

What is the role of tembetarine in plants?

Tembetarine is a plant metabolite.

How is (S)-tembetarine related to (R)-reticuline?

(S)-tembetarine is obtained by methylation of the tertiary amino function of (R)-reticuline.

What is the relationship between tembetarine and (R)-tembetarine?

Tembetarine is an enantiomer of (R)-tembetarine.

※ Please kindly note that our products are for research use only.