Tetrahydroepiberberine

Catalog Number	ACM38853677-1
CAS Number	38853-67-7
Description	Tetrahydroepiberberine is an alkaloid that belongs to the group of inorganic acids. It is found in plants, such as sinomenine, which are used in traditional Chinese medicine. Tetrahydroepiberberine can be extracted from these plants using hydrochloric acid and immiscible solvents. The extraction yield depends on the plant species and the extraction conditions. Tetrahydroepiberberine has been shown to inhibit endothelial cell proliferation, which may be due to its ability to inhibit protein synthesis by blocking the activity of ribosomes. Tetrahydroepiberberine also has a high detection sensitivity for detection of drugs such as cocaine and amphetamines.
Molecular Weight	339.4 g/mol
Molecular Formula	C20H21NO4
Canonical SMILES	COC1=C(C=C2C3CC4=C(CN3CCC2=C1)C5=C(C=C4)OCO5)OC

Custom Q&A

What is the chemical formula of Tetrahydroepiberberine (Sinactine)?

The chemical formula of Tetrahydroepiberberine (Sinactine) is C20H21NO4.

What is the molecular weight of Tetrahydroepiberberine (Sinactine)?

The molecular weight of Tetrahydroepiberberine (Sinactine) is 339.39.

At what temperature does Tetrahydroepiberberine (Sinactine) melt in ethanol?

Tetrahydroepiberberine (Sinactine) melts at 175℃ in ethanol.

What is the density of Tetrahydroepiberberine (Sinactine) at 20 ºC and 760 Torr?

The density of Tetrahydroepiberberine (Sinactine) is 1.33±0.1 g/cm3 at 20 ºC and 760 Torr.

In what type of solvents is Tetrahydroepiberberine (Sinactine) soluble?

Tetrahydroepiberberine (Sinactine) is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

How should Tetrahydroepiberberine (Sinactine) be stored?

Tetrahydroepiberberine (Sinactine) should be stored at -20°C.

What is the main usage of Tetrahydroepiberberine (Sinactine)?

Tetrahydroepiberberine (Sinactine) is an isoquinoline alkaloid displaying antioxidant and antibacterial activity.

What is the specific activity of Tetrahydroepiberberine (Sinactine)?

The specific activity of Tetrahydroepiberberine (Sinactine) is as an alkaloid.

Are there any known synonyms for Tetrahydroepiberberine (Sinactine)?

Yes, some synonyms for Tetrahydroepiberberine (Sinactine) include Sinactin, Canadine, and (+)-sinactine.

What is the chemical structure of Tetrahydroepiberberine (Sinactine)?

The chemical structure of Tetrahydroepiberberine (Sinactine) is described as 12H-Benzo[a]-1,3-benzodioxolo[4,5-g]quinolizine, 6,6a,11,14-tetrahydro-8,9-dimethoxy-

※ Please kindly note that our products are for research use only.