Tetrahydropiperine

Catalog Number	ACM23434880-1
CAS Number	23434-88-0
Structure
Synonyms	Cosmoperine
Molecular Weight	289.4
Molecular Formula	C17H23NO3
InChI	InChI=1S/C17H23NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h8-9,12H,1-7,10-11,13H2
InChI Key	APZYKUZPJCQGPP-UHFFFAOYSA-N
Purity	95%+
Complexity	341
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	289.1677936
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Monoisotopic Mass	289.1677936
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	38.8 Ų

Custom Q&A

What is the chemical formula for Tetrahydropiperine?

The chemical formula for Tetrahydropiperine is C17H23NO3.

What is the molecular weight of Tetrahydropiperine?

The molecular weight of Tetrahydropiperine is 289.37 g/mol.

What is the boiling point of Tetrahydropiperine?

The boiling point of Tetrahydropiperine is 261 °C at a pressure of 14 Torr.

In which solvents is Tetrahydropiperine soluble?

Tetrahydropiperine is soluble in DMF, DMSO, ethanol, and ethyl acetate.

What is the biological activity of Tetrahydropiperine?

Tetrahydropiperine inhibits the cytochrome P450 (CYP) isoform CYP1A1/aryl hydrocarbon hydroxylase.

From which plant is Tetrahydropiperine derived?

Tetrahydropiperine is derived from the near-ripe or ripe fruit of Piper nigrum L, also known as black pepper.

What is the chemical property of Tetrahydropiperine in terms of its solubility in water?

Tetrahydropiperine is insoluble in water.

What is the LogP value of Tetrahydropiperine?

The LogP value of Tetrahydropiperine is 3.674.

What is the target enzyme inhibited by Tetrahydropiperine?

Tetrahydropiperine inhibits the CYP1A1 enzyme.

What is the color and physical form of Tetrahydropiperine?

Tetrahydropiperine is a light yellow crystalline powder.

※ Please kindly note that our products are for research use only.