Thermopsine

Thermopsine

Inquiry
Catalog Number ACM486908
CAS Number 486-90-8
Structure
Description Thermopsine is a quinolizidine alkaloid isolated from the fruits and pods and stem bark of Sophora velutina subsp. Thermopsine has antibacterial activity.
Synonyms (7R,14R,14aS)-1,3,4,6,7,13,14,14a-Octahydro-7,14-methano-2H,11H-dipyrido[1,2-a:1',2'-e][1,5]diazocin-11-one
Molecular Weight 244.33
Molecular Formula C15H20N2O
Canonical SMILES O=C1C=CC=C2N1C[C@]3([H])[C@@](CCCC4)([H])N4C[C@@]2([H])C3
InChI InChI=1S/C15H20N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h3,5-6,11-13H,1-2,4,7-10H2/t11-,12-,13+/m1/s1
InChI Key FQEQMASDZFXSJI-UPJWGTAASA-N
Melting Point 205-206 °C
Purity 98%+
Appearance Solid
Storage Powder-20°C, 3 years; In solvent-80°C. 6 months; -20°C, 1 month.
Complexity 440
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 3
Exact Mass 244.157563266
Heavy Atom Count 18
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 0
Isomeric SMILES C1CCN2C[C@H]3C[C@@H]([C@@H]2C1)CN4C3=CC=CC4=O
Monoisotopic Mass 244.157563266
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 23.6 Ų
Custom Q&A

What is the predicted pka value of Thermopsine?

The predicted pka value is 9.71±0.20.

What are the synonyms of Thermopsine?

The synonyms mentioned are: 7,14-Methano-4H,6H-dipyrido(1,2-A:1',2'-E)(1,5)diazocin-4-one, 7,7A,8,9,10,11,13,14-octahydro-, (7S-(7A,7aalpha,14alpha))-; 7,14-Methano-2H,11H-dipyrido[1,2-a:1',2'-e][1,5]diazocin-11-one, 1,3,4,6,7,13,14,14a-octahydro-, (7S,14S,14aR)-

What is the CAS number of Thermopsine?

The CAS number is 53584-33-1.

What is the molecular formula of Thermopsine?

The molecular formula is C15H20N2O.

What is the molecular weight of Thermopsine?

The molecular weight is 244.33.

What is the melting point of Thermopsine?

The melting point is 207-209 °C (sublm).

What is the predicted boiling point of Thermopsine?

The predicted boiling point is 455.6±34.0 °C.

What is the density of Thermopsine?

The density is 1.257 g/cm3.

※ Please kindly note that our products are for research use only.