Thiocolchicine

Catalog Number	ACM2730714
CAS Number	2730-71-4
Synonyms	Colchicine,10-thio-
IUPAC Name	N-[(7S)-1,2,3-Trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide
Molecular Weight	415.50
Molecular Formula	C22H25NO5S
Canonical SMILES	CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)SC)OC)OC)OC
InChI	InChI=1S/C22H25NO5S/c1-12(24)23-16-8-6-13-10-18(26-2)21(27-3)22(28-4)20(13)14-7-9-19(29-5)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24)/t16-/m0/s1
InChI Key	CMEGANPVAXDBPL-INIZCTEOSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	744
Exact Mass	415.14534407
Heavy Atom Count	29
Isomeric SMILES	CC(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)SC)OC)OC)OC
Monoisotopic Mass	415.14534407
Topological Polar Surface Area	99.2Ų

Custom Q&A

What is the chemical formula of thiocolchicine?

The chemical formula of thiocolchicine is C22H25NO5S.

What is the molecular weight of thiocolchicine?

The molecular weight of thiocolchicine is 415.5.

What is the melting point of thiocolchicine?

The melting point of thiocolchicine is 193°C.

What is the solubility of thiocolchicine in DMSO?

Thiocolchicine is soluble in DMSO at a concentration of 10mg/mL, and the solution is clear.

What color is thiocolchicine in its powdered form?

Thiocolchicine is in the form of a white to beige powder.

What are the hazard codes associated with thiocolchicine?

The hazard code for thiocolchicine is Xi.

What is the main usage of thiocolchicine?

Thiocolchicine is used as a muscle relaxant.

What is the main biochem/physiol action of thiocolchicine?

Thiocolchicine is an antimitotic alkaloid and apoptosis inducer that inhibits tubulin polymerization and microtubule assembly.

How is thiocolchicine stored?

Thiocolchicine should be stored at -20°C.

What is the boiling point of thiocolchicine?

The predicted boiling point of thiocolchicine is 729.1±60.0°C.

※ Please kindly note that our products are for research use only.