Thiocolchicoside

Catalog Number	ACM602415-1
CAS Number	602-41-5
Synonyms	Coltramyl
IUPAC Name	N-[(7S)-1,2-Dimethoxy-10-methylsulfanyl-9-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide
Molecular Weight	563.60
Molecular Formula	C27H33NO10S
Canonical SMILES	CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)SC)OC)OC)OC4C(C(C(C(O4)CO)O)O)O
InChI	InChI=1S/C27H33NO10S/c1-12(30)28-16-7-5-13-9-18(37-27-24(34)23(33)22(32)19(11-29)38-27)25(35-2)26(36-3)21(13)14-6-8-20(39-4)17(31)10-15(14)16/h6,8-10,16,19,22-24,27,29,32-34H,5,7,11H2,1-4H3,(H,28,30)/t16-,19+,22+,23-,24+,27+/m0/s1
InChI Key	LEQAKWQJCITZNK-AXHKHJLKSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	1010
Exact Mass	563.18251742
Heavy Atom Count	39
Isomeric SMILES	CC(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)SC)OC)OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O
Monoisotopic Mass	563.18251742
Topological Polar Surface Area	189Ų

Custom Q&A

What is the chemical formula for Thiocolchicoside?

The chemical formula for Thiocolchicoside is C27H33NO10S.

What is the molecular weight of Thiocolchicoside?

The molecular weight of Thiocolchicoside is 563.62.

What is the melting point of Thiocolchicoside?

The melting point of Thiocolchicoside is 190-198°C.

What is the boiling point of Thiocolchicoside?

The boiling point of Thiocolchicoside is predicted to be 929.6±65.0 °C.

What is the solubility of Thiocolchicoside in methanol and water?

Thiocolchicoside is slightly soluble in methanol when heated and slightly soluble in water.

What is the color of Thiocolchicoside?

Thiocolchicoside is a yellow solid, ranging from light yellow to yellow in color.

How is Thiocolchicoside stored?

Thiocolchicoside is stored in a refrigerator.

What is the usage of Thiocolchicoside?

Thiocolchicoside is a GABA receptor antagonist prescribed as a muscle relaxant with analgesic effects.

What is the safety information regarding Thiocolchicoside?

The LD50 intraperitoneal in mouse for Thiocolchicoside is 1mg/kg.

What is the chemical property of Thiocolchicoside?

Thiocolchicoside is a yellow solid.

※ Please kindly note that our products are for research use only.