Thymidine

Catalog Number	ACM50895-1
CAS Number	50-89-5
Synonyms	Deoxythymidine
IUPAC Name	1-[(2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione
Molecular Weight	242.23
Molecular Formula	C10H14N2O5
Canonical SMILES	CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)O
InChI	InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1
InChI Key	IQFYYKKMVGJFEH-XLPZGREQSA-N
Purity	98%+(HPLC)
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	381
Exact Mass	242.09027155
Heavy Atom Count	17
Isomeric SMILES	CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O
Monoisotopic Mass	242.09027155
Topological Polar Surface Area	99.1Ų

Custom Q&A

What is the chemical formula of Thymidine?

The chemical formula of Thymidine is C10H14N2O5.

What is the melting point of Thymidine?

The melting point of Thymidine is 186-188 °C.

In what form does Thymidine exist under standard temperature and pressure conditions?

Thymidine exists as a solid, as white crystals or as white crystalline powder.

What is the role of Thymidine in DNA?

Thymidine pairs with adenine in the DNA double helix.

How is Thymidine used in cell biology?

Thymidine is used to synchronize cells in G1/early S phase.

What are the physical properties of Thymidine?

Thymidine is a white needle crystal and is soluble in methanol, ethanol, DMSO, and other organic solvents.

What is the mechanism of action of Thymidine?

High concentrations of Thymidine competitively inhibit the deoxynucleotide metabolism pathway, blocking DNA replication.

What safety information is provided for Thymidine?

Thymidine is moderately toxic by the intraperitoneal route, an experimental teratogen, and emits toxic fumes of NOx when heated to decomposition.

How does Thymidine differ from thymine?

Thymidine is a nucleoside consisting of one thymine molecule linked to ad-doxyribose sugar molecule, while thymine is a nucleobase.

What is the relevance of Thymidine in the synthesis of active pharmaceutical ingredients?

Thymidine is used in the synthesis of active pharmaceutical ingredients like zidovudine.

※ Please kindly note that our products are for research use only.