Thymidine

Thymidine

Inquiry
Catalog Number ACM50895-1
CAS Number 50-89-5
Structure
Synonyms Deoxythymidine
IUPAC Name 1-[(2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione
Molecular Weight 242.23
Molecular Formula C10H14N2O5
Canonical SMILES CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)O
InChI InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1
InChI Key IQFYYKKMVGJFEH-XLPZGREQSA-N
Purity 98%+(HPLC)
Storage Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity 381
Exact Mass 242.09027155
Heavy Atom Count 17
Isomeric SMILES CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O
Monoisotopic Mass 242.09027155
Topological Polar Surface Area 99.1Ų
Custom Q&A

What is the chemical formula of Thymidine?

The chemical formula of Thymidine is C10H14N2O5.

What is the melting point of Thymidine?

The melting point of Thymidine is 186-188 °C.

In what form does Thymidine exist under standard temperature and pressure conditions?

Thymidine exists as a solid, as white crystals or as white crystalline powder.

What is the role of Thymidine in DNA?

Thymidine pairs with adenine in the DNA double helix.

How is Thymidine used in cell biology?

Thymidine is used to synchronize cells in G1/early S phase.

What are the physical properties of Thymidine?

Thymidine is a white needle crystal and is soluble in methanol, ethanol, DMSO, and other organic solvents.

What is the mechanism of action of Thymidine?

High concentrations of Thymidine competitively inhibit the deoxynucleotide metabolism pathway, blocking DNA replication.

What safety information is provided for Thymidine?

Thymidine is moderately toxic by the intraperitoneal route, an experimental teratogen, and emits toxic fumes of NOx when heated to decomposition.

How does Thymidine differ from thymine?

Thymidine is a nucleoside consisting of one thymine molecule linked to ad-doxyribose sugar molecule, while thymine is a nucleobase.

What is the relevance of Thymidine in the synthesis of active pharmaceutical ingredients?

Thymidine is used in the synthesis of active pharmaceutical ingredients like zidovudine.

※ Please kindly note that our products are for research use only.