Tomatidine

Catalog Number	ACM77598-1
CAS Number	77-59-8
Description	Anti-inflammatory; cholesterol acyl-transferase inhibitor; glycoalkaloid
Molecular Weight	415.65 g/mol
Molecular Formula	C27H45NO2
Canonical SMILES	C[C@H]1CC[C@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@@H]6[C@@]5(CC[C@@H](C6)O)C)C)C)NC1
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939791000 - UK: 2939790000 - China: 2939799090
MDL Number	MFCD00075644

Custom Q&A

What is the chemical formula of TOMATIDINE?

The chemical formula of TOMATIDINE is C27H45NO2.

What is the Melting point of TOMATIDINE?

The Melting point of TOMATIDINE is 210.5℃.

What are the Pharmaceutical Properties of TOMATIDINE?

TOMATIDINE possesses antimicrobial, antifungal, and antiviral properties. It also stimulates mTORC1 signaling and anabolism.

What is the main pharmaceutical family TOMATIDINE belongs to?

TOMATIDINE belongs to the Spirosolanes and Derivatives chemical family.

How does TOMATIDINE affect cholesterol ester accumulation?

TOMATIDINE significantly inhibits cholesterol ester accumulation induced by acetylated LDL in human monocyte-derived macrophages.

How is TOMATIDINE purified?

TOMATIDINE can be purified by dissolving it in *C6H6 and applying it to an Al2O3 column.

What is the Risk Statement associated with TOMATIDINE?

The Risk Statement for TOMATIDINE is 23/25.

What is the Safety Statement about TOMATIDINE?

The Safety Statements for TOMATIDINE are 1-45.

What is the refractive index of TOMATIDINE?

The refractive index of TOMATIDINE is estimated to be 1.6840.

What is the storage temperature recommended for TOMATIDINE?

TOMATIDINE should be stored at -20°C.

※ Please kindly note that our products are for research use only.