Tombozine

Tombozine

Inquiry
Catalog Number ACM126640980
CAS Number 126640-98-0 / 124096-81-7 / 604-99-9
Synonyms Normacusine B
Molecular Weight 294.4
InChI InChI=1S/C19H22N2O/c1-2-11-9-21-17-8-14-12-5-3-4-6-16(12)20-19(14)18(21)7-13(11)15(17)10-22/h2-6,13,15,17-18,20,22H,7-10H2,1H3
InChI Key VXTDUGOBAOLMED-UHFFFAOYSA-N
Purity 95%+
Complexity 490
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 294.17321333
Heavy Atom Count 22
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 2
Monoisotopic Mass 294.17321333
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 39.3 Ų
Custom Q&A

What is the product name of the compound with CAS number 604-99-9?

The product name of the compound with CAS number 604-99-9 is (+)-Normacusine B.

What are some synonyms for (+)-Normacusine B?

Some synonyms for (+)-Normacusine B are Normacusine B, Sarpagan-17-ol, Tombozine, Vellosiminol, and Vellosimol.

What is the molecular formula of (+)-Normacusine B?

The molecular formula of (+)-Normacusine B is C19H22N2O.

What is the molecular weight of (+)-Normacusine B?

The molecular weight of (+)-Normacusine B is 294.4.

What is the melting point range of (+)-Normacusine B?

The melting point range of (+)-Normacusine B is 270-272°C.

In what solvents is (+)-Normacusine B soluble?

(+)-Normacusine B is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

Where has this carboline alkaloid been isolated from?

This carboline alkaloid has been isolated from the stem bark of Strychnos nedeola and the trunk bark of Tabernaernontana brachyantha.

How has the structure of (+)-Normacusine B been established?

The structure of (+)-Normacusine B has been established on the basis of spectroscopic evidence.

What is the predicted boiling point of (+)-Normacusine B?

The predicted boiling point of (+)-Normacusine B is 472.7±45.0 °C.

What is the predicted pka value of (+)-Normacusine B?

The predicted pka value of (+)-Normacusine B is 14.79±0.10.

※ Please kindly note that our products are for research use only.