Trachelanthine

Catalog Number	ACM510190
CAS Number	510-19-0
Synonyms	(1R,7aS)-1-[[[(2S,3R)-2,3-Dihydroxy-2-isopropylbutanoyl]oxy]methyl]hexahydro-1H-pyrrolizine 4-oxide
Molecular Weight	301.38
InChI	InChI=1S/C15H27NO5/c1-10(2)15(19,11(3)17)14(18)21-9-12-6-8-16(20)7-4-5-13(12)16/h10-13,17,19H,4-9H2,1-3H3/t11?,12-,13+,15-,16/m1/s1
InChI Key	DLNWZIVYKQXLTN-CGYUPCHJSA-N
Purity	95%+
Complexity	402
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	301.18892296
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC(C)[C@@](C(C)O)(C(=O)OC[C@H]1CC[N+]2([C@H]1CCC2)[O-])O
Monoisotopic Mass	301.18892296
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	84.8 Ų

Custom Q&A

What is the chemical name of Trachelanthine?

The chemical name of Trachelanthine is (1R,7aS)-1-[[[(2S,3R)-2,3-Dihydroxy-2-isopropylbutanoyl]oxy]methyl]hexahydro-1H-pyrrolizine 4-oxide.

What are some synonyms of Trachelanthine?

Some synonyms of Trachelanthine include Trachelanthamine N-oxide and Trachelanthine.

What is the CAS number of Trachelanthine?

The CAS number of Trachelanthine is 510-19-0.

What is the molecular formula of Trachelanthine?

The molecular formula of Trachelanthine is C15H27NO5.

What is the molecular weight of Trachelanthine?

The molecular weight of Trachelanthine is 301.38.

What is the pka of Trachelanthine according to the reference?

The pka of Trachelanthine is 12.58±0.29.

What is the predicted pka of Trachelanthine?

The predicted pka of Trachelanthine is 12.58.

What is the molar mass of Trachelanthine?

The molar mass of Trachelanthine is 301.38 g/mol.

What is the structure of Trachelanthine?

The structure of Trachelanthine is a complex hexahydro-pyrrolizine compound.

What are some common uses or applications of trachelanthine in the industry?

Trachelanthine is commonly used in the industry for its potential medicinal properties, including as an ingredient in herbal medicines or supplements.

※ Please kindly note that our products are for research use only.