trans-13-Cinnamoyloxylupanine

Catalog Number	ACM5835041
CAS Number	5835-04-1
Structure
Description	Trans-13-Cinnamoyloxylupanine is a reference material that is isolated from the leaves of the plant Cinnamomum camphora. It is a primary metabolite that can be used as a standard for HPLC analysis. Trans-13-Cinnamoyloxylupanine has been shown to have anti-inflammatory and antioxidant effects, which may be due to its ability to inhibit prostaglandin synthesis. This compound also has been shown to have anticancer properties in vitro and in vivo. Trans-13-Cinnamoyloxylupanine is structurally related to other cinnamoyloxyphenols such as trans-caffeoylquinic acid and trans-feruloylquinic acid.
Molecular Weight	394.51 g/mol
Molecular Formula	C24H30N2O3
Canonical SMILES	O=C(O[C@H]1CCN2C[C@@H]3C[C@@H](CN4[C@@H]3CCCC4=O)[C@@H]2C1)\C=C\c5ccccc5
Storage	store at 2℃-8℃
Harmonized Tariff Code	Switzerland: 29337900 - USA: 2933790800 - Slovakia: 2933790090 - UK: 2933790090 - China: 2933790099
MDL Number	MFCD31726203

Custom Q&A

What is the molecular formula of TRANS-13-CINNAMOYLOXYLUPANINE?

The molecular formula is C24H30N2O3.

What is the molecular weight of TRANS-13-CINNAMOYLOXYLUPANINE?

The molecular weight is 394.51.

Can TRANS-13-CINNAMOYLOXYLUPANINE be used in pharmaceutical applications?

It is possible that TRANS-13-CINNAMOYLOXYLUPANINE has pharmaceutical applications, but further research would be needed to determine its potential uses.

How is TRANS-13-CINNAMOYLOXYLUPANINE synthesized?

The synthesis of TRANS-13-CINNAMOYLOXYLUPANINE could involve multiple steps and reactions, depending on the starting materials and desired final product.

Are there any known biological activities or effects associated with TRANS-13-CINNAMOYLOXYLUPANINE?

Further studies would be needed to determine any specific biological activities or effects of TRANS-13-CINNAMOYLOXYLUPANINE.

※ Please kindly note that our products are for research use only.