Trichophydine

Catalog Number	ACM67031543
CAS Number	67031-54-3
Synonyms	Benzenemethanol, α-(aminomethyl)-, 1-benzoate
Molecular Weight	241.28
InChI	InChI=1S/C15H15NO2/c16-11-14(12-7-3-1-4-8-12)18-15(17)13-9-5-2-6-10-13/h1-10,14H,11,16H2
InChI Key	JFWCBGMWRXJFDF-UHFFFAOYSA-N
Purity	95%+
Complexity	255
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	241.110278721
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	241.110278721
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	52.3 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 67031-54-3?

The chemical name is 2-Amino-1-phenylethyl=benzoate, also known as Trichophydine.

What are some synonyms for Trichophydine?

Some synonyms for Trichophydine include Benzenemethanol, α-(aminomethyl)-, 1-benzoate.

What is the molecular formula of Trichophydine?

The molecular formula is C15H15NO2.

What is the molecular weight of Trichophydine?

The molecular weight is 241.29.

What is the predicted boiling point of Trichophydine?

The predicted boiling point is 384.2±30.0 °C.

What is the predicted density of Trichophydine?

The predicted density is 1.154±0.06 g/cm3.

What is the predicted pKa of Trichophydine?

The predicted pKa is 7.26±0.10.

What is the significance of the CAS number 67031-54-3?

The CAS number uniquely identifies Trichophydine in chemical databases.

How is Trichophydine commonly used?

Trichophydine may be used in research or pharmaceutical applications.

What are some potential properties or characteristics of Trichophydine?

Some potential properties include its chemical structure, boiling point, density, and pKa value.

※ Please kindly note that our products are for research use only.