1-(3,4,5-Trihydroxypentanoyl)-β-carboline

Catalog Number	ACM180995408
CAS Number	180995-40-8
IUPAC Name	(3S,4R)-3,4,5-Trihydroxy-1-(9H-pyrido[3,4-b]indol-1-yl)pentan-1-one
Molecular Weight	300.31
Molecular Formula	C16H16N2O4
Canonical SMILES	C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C(=O)CC(C(CO)O)O
InChI	InChI=1S/C16H16N2O4/c19-8-14(22)12(20)7-13(21)16-15-10(5-6-17-16)9-3-1-2-4-11(9)18-15/h1-6,12,14,18-20,22H,7-8H2/t12-,14+/m0/s1
InChI Key	RSEGMZMZRFXVDC-GXTWGEPZSA-N
Purity	97%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	406
Exact Mass	300.11100700
Heavy Atom Count	22
Isomeric SMILES	C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C(=O)C[C@@H]([C@@H](CO)O)O
Monoisotopic Mass	300.11100700
Topological Polar Surface Area	106Ų

Custom Q&A

What is the chemical formula of 1-(3,4,5-Trihydroxypentanoyl)-β-carboline?

The chemical formula is C16H16N2O4.

What is the molecular weight of 1-(3,4,5-Trihydroxypentanoyl)-β-carboline?

The molecular weight is 300.31.

What is the CAS number of 1-(3,4,5-Trihydroxypentanoyl)-β-carboline?

The CAS number is 180995-40-8.

What is the predicted boiling point of 1-(3,4,5-Trihydroxypentanoyl)-β-carboline?

The predicted boiling point is 677.0±55.0 °C.

What is the density of 1-(3,4,5-Trihydroxypentanoyl)-β-carboline?

The predicted density is 1.475±0.06 g/cm3.

What is the predicted pKa value of 1-(3,4,5-Trihydroxypentanoyl)-β-carboline?

The predicted pKa value is 13.35±0.20.

How many hydroxy groups are present in 1-(3,4,5-Trihydroxypentanoyl)-β-carboline?

There are three hydroxy groups present.

What is another name for 1-(3,4,5-Trihydroxypentanoyl)-β-carboline?

Another name is D-erythro-Pentose, 2-deoxy-1-C-9H-pyrido[3,4-b]indol-1-yl-.

What are some other synonyms for 1-(3,4,5-Trihydroxypentanoyl)-β-carboline?

Some other synonyms include 1-(3,4,5-Trihydroxypentanoyl)-β-carboline.

※ Please kindly note that our products are for research use only.