Tropanyl trans-cinnamate

Catalog Number	ACM35721927
CAS Number	35721-92-7
Structure
Molecular Weight	271.35
InChI	InChI=1S/C17H21NO2/c1-18-14-7-8-15(18)10-13(9-14)16(11-17(19)20)12-5-3-2-4-6-12/h2-6,11,13-15H,7-10H2,1H3,(H,19,20)/b16-11-
InChI Key	KXRXYBFOJWGYEH-WJDWOHSUSA-N
Purity	95%+
Complexity	384
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	271.157228913
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1C2CCC1CC(C2)/C(=C\C(=O)O)/C3=CC=CC=C3
Monoisotopic Mass	271.157228913
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	40.5 Ų

Custom Q&A

What is the chemical name of Tropanyl trans-cinnamate?

The chemical name of Tropanyl trans-cinnamate is 2-Propenoic acid, 3-phenyl-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, (2E)-.

What is the CAS number of Tropanyl trans-cinnamate?

The CAS number of Tropanyl trans-cinnamate is 35721-92-7.

What is the molecular formula of Tropanyl trans-cinnamate?

The molecular formula of Tropanyl trans-cinnamate is C17H21NO2.

What is the molecular weight of Tropanyl trans-cinnamate?

The molecular weight of Tropanyl trans-cinnamate is 271.35.

What is the predicted boiling point of Tropanyl trans-cinnamate?

The predicted boiling point of Tropanyl trans-cinnamate is 386.2±35.0 °C.

What is the predicted density of Tropanyl trans-cinnamate?

The predicted density of Tropanyl trans-cinnamate is 1.14±0.1 g/cm3.

What is the predicted pka value of Tropanyl trans-cinnamate?

The predicted pka value of Tropanyl trans-cinnamate is 10.00±0.40.

How many nitrogen atoms are present in the molecular formula of Tropanyl trans-cinnamate?

There is one nitrogen atom present in the molecular formula of Tropanyl trans-cinnamate.

What is the stereochemistry of Tropanyl trans-cinnamate?

The stereochemistry of Tropanyl trans-cinnamate is specified as (3-endo).

What is the predicted molar mass of Tropanyl trans-cinnamate?

The predicted molar mass of Tropanyl trans-cinnamate is approximately 271.35 g/mol.

※ Please kindly note that our products are for research use only.