Tryprostatin A

Catalog Number	ACM171864805
CAS Number	171864-80-5
Synonyms	TPS-A
Molecular Weight	381.5
InChI	InChI=1S/C22H27N3O3/c1-13(2)6-9-17-16(15-8-7-14(28-3)11-18(15)23-17)12-19-22(27)25-10-4-5-20(25)21(26)24-19/h6-8,11,19-20,23H,4-5,9-10,12H2,1-3H3,(H,24,26)/t19-,20-/m0/s1
InChI Key	XNRPVPHNDQHWLJ-PMACEKPBSA-N
Purity	95%+
Complexity	645
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	381.20524173
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC(=CCC1=C(C2=C(N1)C=C(C=C2)OC)C[C@H]3C(=O)N4CCC[C@H]4C(=O)N3)C
Monoisotopic Mass	381.20524173
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	74.4 Ų

Custom Q&A

What is the chemical formula of TRYPROSTATIN A?

The chemical formula of TRYPROSTATIN A is C22H27N3O3.

What is the molecular weight of TRYPROSTATIN A?

The molecular weight of TRYPROSTATIN A is 381.47.

What is the melting point of TRYPROSTATIN A?

The melting point of TRYPROSTATIN A is 119-120 °C.

What is the boiling point of TRYPROSTATIN A?

The predicted boiling point of TRYPROSTATIN A is 666.4±55.0 °C.

What is the density of TRYPROSTATIN A?

The predicted density of TRYPROSTATIN A is 1.26±0.1 g/cm3.

What form does TRYPROSTATIN A come in?

TRYPROSTATIN A is in the form of a white powder.

How is TRYPROSTATIN A synthesized?

TRYPROSTATIN A is a cyclic dipeptide that is brevianamide F (cyclo-L-Trp-L-Pro) substituted at positions 2 and 6 on the indole ring by prenyl and methoxy groups, respectively.

What is the role of TRYPROSTATIN A?

TRYPROSTATIN A has a role as a breast cancer resistance protein inhibitor.

What are the chemical properties of TRYPROSTATIN A?

TRYPROSTATIN A is a dipeptide, a member of indoles, a pyrrolopyrazine, an aromatic ether, and an indole alkaloid.

How is TRYPROSTATIN A functionally related to brevianamide F?

TRYPROSTATIN A is functionally related to brevianamide F.

※ Please kindly note that our products are for research use only.