Ungeremine

Catalog Number	ACM72510044
CAS Number	72510-04-4
Synonyms	Lycobetaine
Molecular Weight	266.27
InChI	InChI=1S/C16H11NO3/c18-11-3-9-1-2-17-7-10-4-14-15(20-8-19-14)6-12(10)13(5-11)16(9)17/h3-7H,1-2,8H2/p+1
InChI Key	DFQOXFIPAAMFAU-UHFFFAOYSA-O
Purity	98%+
Complexity	403
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	266.08171824
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	266.08171824
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	42.6 Ų

Custom Q&A

What is the chemical formula of ungeremine?

The chemical formula of ungeremine is C16H12NO3.

What is the molecular weight of ungeremine?

The molecular weight of ungeremine is 266.275.

What is the melting point of ungeremine?

The melting point of ungeremine is 270-272°C (dec.).

What is the boiling point of ungeremine?

The boiling point of ungeremine is estimated to be 409.48°C.

What is the density of ungeremine?

The density of ungeremine is roughly estimated to be 1.1727.

What is the refractive index of ungeremine?

The refractive index of ungeremine is estimated to be 1.5300.

How is ungeremine stored?

Ungeremine is stored at -20°C.

What is the solubility of ungeremine in methanol?

Ungeremine has a solubility of 10 mg/ml in methanol.

In which plants is ungeremine found?

Ungeremine is a natural product found particularly in Pancratium maritimum and Nerine bowdenii.

What other name is ungeremine known by?

Ungeremine is also known as Lycobetaine.

※ Please kindly note that our products are for research use only.