Uplandicine

Catalog Number	ACM74202101
CAS Number	74202-10-1
Molecular Weight	357.4
InChI	InChI=1S/C17H27NO7/c1-10(19)17(23,16(3,4)22)15(21)24-9-12-5-7-18-8-6-13(14(12)18)25-11(2)20/h5,10,13-14,19,22-23H,6-9H2,1-4H3/t10-,13+,14+,17-/m0/s1
InChI Key	IHRIHUJNKKMIDN-YYGKBEQOSA-N
Purity	95%+
Complexity	573
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	357.1787522
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	3
Isomeric SMILES	C[C@@H]([C@](C(=O)OCC1=CCN2[C@H]1[C@@H](CC2)OC(=O)C)(C(C)(C)O)O)O
Monoisotopic Mass	357.1787522
PhysicalState	Powder
Rotatable Bond Count	8
Topological Polar Surface Area	117 Ų

Custom Q&A

What is the chemical formula of UPLANDICINE?

The chemical formula of UPLANDICINE is C17H27NO7.

What is the molecular weight of UPLANDICINE?

The molecular weight of UPLANDICINE is 357.39878.

What is the boiling point of UPLANDICINE?

The boiling point of UPLANDICINE is predicted to be 499.3±45.0 °C.

What is the density of UPLANDICINE?

The density of UPLANDICINE is predicted to be 1.31±0.1 g/cm3.

What is the pKa value of UPLANDICINE?

The pKa value of UPLANDICINE is predicted to be 12.45±0.29.

What is the synonym for UPLANDICINE?

The synonym for UPLANDICINE is L-threo-Pentitol, 3-C-[[[(1R,7aR)-1-(acetyloxy)-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methoxy]carbonyl]-1,5-dideoxy-2-C-methyl-.

What is the CAS number for UPLANDICINE?

The CAS number for UPLANDICINE is 74202-10-1.

What category does UPLANDICINE belong to?

UPLANDICINE is a member of pyrrolizines.

Can UPLANDICINE be used for synthesis purposes?

Yes, UPLANDICINE can be used for synthesis purposes.

※ Please kindly note that our products are for research use only.