Uridine

Uridine

Inquiry
Catalog Number ACM58968-2
CAS Number 58-96-8
Synonyms Uracil riboside
IUPAC Name 1-[(2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione
Molecular Weight 244.20
Molecular Formula C9H12N2O6
Canonical SMILES C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O
InChI InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1
InChI Key DRTQHJPVMGBUCF-XVFCMESISA-N
Purity 98%+(HPLC)
Appearance Off-white powder
Storage Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity 371
Exact Mass 244.06953611
Heavy Atom Count 17
Isomeric SMILES C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O
Monoisotopic Mass 244.06953611
Topological Polar Surface Area 119Ų
Custom Q&A

What is the chemical formula of Uridine?

The chemical formula of Uridine is C9H12N2O6.

How is Uridine related to RNA and DNA?

Uridine is one of the five standard nucleosides which make up nucleic acids, including both RNA and DNA. It is found in RNA and not DNA.

How is Uridine synthesized in the body?

Uridine is widely produced in the form of uridine monophosphate through the decarboxylation of orotidylate, being catalyzed by orotidylate decarboxylase.

What role does Uridine play in glycolysis pathway?

Uridine plays a very important role in the glycolysis pathway of galactose.

What are the biological effects of Uridine?

Uridine has many biological effects, including improving brain cholinergic functions, hepatic mitochondrial function, pain physiology, and brain energy utilization.

How does Uridine affect the central nervous system?

Uridine plays a crucial role in the pyrimidine metabolism of the brain, affecting sleep, memory function, neuronal plasticity, and more.

How is Uridine used in the treatment of cystic fibrosis?

Uridine can be used to treat cystic fibrosis by activating alternative Cl secretion pathways and decreasing Na absorption in epithelial cells.

What are the potential effects of Uridine on the circulatory system?

Uridine and its nucleotides have complex effects on isolated blood vessels, sometimes acting directly on smooth muscle cells or stimulating endothelial cells.

How does Uridine modulate reproduction?

Uridine may promote sperm motility and play a role in seminal fluids, but the exact role in fertilization and implantation is not yet clear.

How is Uridine used in cancer treatment?

Uridine and UDP-glucose can be used to counter the unwanted toxicity of pyrimidine-based anticancer drugs and protect against neurotoxic side effects of certain treatments like azidothymidine.

※ Please kindly note that our products are for research use only.