Usaramine N-oxide

Catalog Number	ACM117020549
CAS Number	117020-54-9
Synonyms	Mucronatine N-oxide
IUPAC Name	(1R,4E,6R,7S,17R)-4-Ethylidene-7-hydroxy-7-(hydroxymethyl)-6-methyl-14-oxido-2,9-dioxa-14-azoniatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione
Molecular Weight	367.39
Molecular Formula	C18H25NO7
Canonical SMILES	CC=C1CC(C(C(=O)OCC2=CC[N+]3(C2C(CC3)OC1=O)[O-])(CO)O)C
InChI	InChI=1S/C18H25NO7/c1-3-12-8-11(2)18(23,10-20)17(22)25-9-13-4-6-19(24)7-5-14(15(13)19)26-16(12)21/h3-4,11,14-15,20,23H,5-10H2,1-2H3/b12-3+/t11-,14-,15-,18-,19?/m1/s1
InChI Key	IDIMIWQPUHURPV-BEPQMMTDSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	673
Exact Mass	367.16310214
Heavy Atom Count	26
Isomeric SMILES	C/C=C/1\C[C@H]([C@@](C(=O)OCC2=CC[N+]3([C@H]2[C@@H](CC3)OC1=O)[O-])(CO)O)C
Monoisotopic Mass	367.16310214
Topological Polar Surface Area	111Ų

Custom Q&A

What is the chemical formula of Usaramine N-oxide?

The chemical formula of Usaramine N-oxide is C18H25NO7.

What is the molecular weight of Usaramine N-oxide?

The molecular weight of Usaramine N-oxide is 367.39.

What is the CAS number of Usaramine N-oxide?

The CAS number of Usaramine N-oxide is 117020-54-9.

What are some synonyms for Usaramine N-oxide?

Some synonyms for Usaramine N-oxide include [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-(hydroxymethyl)-5-methyl-, 12-oxide, (3E,5R,6S,14aR,14bR)-.

What is the predicted pKa value of Usaramine N-oxide?

The predicted pKa value of Usaramine N-oxide is 11.96±0.40.

What is the predicted pKa value used for in chemistry?

The pKa value is used to predict the acidity or basicity of chemical compounds.

How many oxygen atoms are present in the molecular structure of Usaramine N-oxide?

There are 7 oxygen atoms present in the molecular structure of Usaramine N-oxide.

How many nitrogen atoms are present in the molecular structure of Usaramine N-oxide?

There is 1 nitrogen atom present in the molecular structure of Usaramine N-oxide.

What is the stereochemistry of Usaramine N-oxide?

The stereochemistry of Usaramine N-oxide is (3E,5R,6S,14aR,14bR)-.

How many hydrogen atoms are present in the molecular structure of Usaramine N-oxide?

The number of hydrogen atoms in the molecular structure of Usaramine N-oxide can be calculated by subtracting the sum of the atomic weights of carbon, nitrogen, and oxygen atoms from the molecular weight of Usaramine N-oxide.

※ Please kindly note that our products are for research use only.