Valeroidine

Catalog Number	ACM490960
CAS Number	490-96-0
Synonyms	[(3R,7R)-7-Hydroxy-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 3-methylbutan oate
Molecular Weight	241.33
InChI	InChI=1S/C13H23NO3/c1-8(2)4-13(16)17-10-5-9-6-12(15)11(7-10)14(9)3/h8-12,15H,4-7H2,1-3H3/t9,10-,11,12-/m1/s1
InChI Key	APLLVFVOTXZBFO-RUJICJSRSA-N
Melting Point	85 °C
Purity	95%+
Complexity	292
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	241.1677936
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC(C)CC(=O)O[C@@H]1CC2C[C@H](C(C1)N2C)O
Monoisotopic Mass	241.1677936
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	49.8 Ų

Custom Q&A

What is the chemical formula of Valeroidine?

The chemical formula of Valeroidine is C13H23NO3.

What is the molecular weight of Valeroidine?

The molecular weight of Valeroidine is 241.33 g/mol.

What is the melting point of Valeroidine?

The melting point of Valeroidine is 85°C.

What is the boiling point of Valeroidine?

The boiling point of Valeroidine is 163-167 °C (at 2 Torr).

What is the density of Valeroidine?

The density of Valeroidine is 1.11 ± 0.1 g/cm3.

In which plant is Valeroidine found?

Valeroidine is found in Duboisia myoporoides.

How does Valeroidine crystallize?

Valeroidine crystallizes from EtOH in colorless, nacreous plates.

What is the chemical classification of Valeroidine?

Valeroidine is classified as a tropane alkaloid.

What is the chemical reaction of Valeroidine with thionyl chloride?

Treatment of Valeroidine with thionyl chloride gives norvaleroidine due to demethylation.

How does Valeroidine hydrolyze in aqueous Ba(OH)2?

On hydrolysis with aqueous Ba(OH)2, Valeroidine gives dihydroxytropane and isovaleric acid.

※ Please kindly note that our products are for research use only.