Vallesiachotamine

Catalog Number	ACM5523375
CAS Number	5523-37-5
Synonyms	(15S,16E)-16,17,20,21-Tetradehydro-16-formyl-18,19-secoyohimban-19-oic acid methyl ester
Molecular Weight	350.4
InChI	InChI=1S/C21H22N2O3/c1-3-13(12-24)16-10-19-20-15(14-6-4-5-7-18(14)22-20)8-9-23(19)11-17(16)21(25)26-2/h3-7,11-12,16,19,22H,8-10H2,1-2H3/b13-3-/t16-,19-/m0/s1
InChI Key	NTVLUSJWJRSPSM-JXSBNBLESA-N
Melting Point	247-249 °C
Purity	95%+
Complexity	641
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	350.16304257
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C(/C=O)\[C@@H]1C[C@H]2C3=C(CCN2C=C1C(=O)OC)C4=CC=CC=C4N3
Monoisotopic Mass	350.16304257
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	62.4 Ų

Custom Q&A

What is the chemical name of Vallesiachotamine with the CAS number 5523-37-5?

The chemical name is (15S,16E)-16,17,20,21-Tetradehydro-16-formyl-18,19-secoyohimban-19-oic acid methyl ester.

What is another name for Vallesiachotamine?

Another name for Vallesiachotamine is Vallesiachotamine.

What is the molecular formula of Vallesiachotamine?

The molecular formula is C21H22N2O3.

What is the molecular weight of Vallesiachotamine?

The molecular weight is 350.41.

What is the melting point of Vallesiachotamine?

The melting point is 247-249 °C (decomp).

What is the predicted boiling point of Vallesiachotamine?

The predicted boiling point is 566.8 ± 50.0 °C.

What is the predicted density of Vallesiachotamine?

The predicted density is 1.28 ± 0.1 g/cm3.

What is the predicted pKa value of Vallesiachotamine?

The predicted pKa value is 17.46 ± 0.60.

What is the structure of Vallesiachotamine?

Vallesiachotamine has a molecular structure (15S,16E)-16,17,20,21-Tetradehydro-16-formyl-18,19-secoyohimban-19-oic acid methyl ester.

What are some synonyms for Vallesiachotamine?

Some synonyms for Vallesiachotamine include Indolo[2,3-a]quinolizine-3-carboxylic acid, 2-[(1E)-1-formyl-1-propen-1-yl]-1,2,6,7,12,12b-hexahydro-, methyl ester, (2S,12bS)-.

※ Please kindly note that our products are for research use only.