Valtropine

Catalog Number	ACM495829
CAS Number	495-82-9
Structure
Synonyms	(2S)-2-Methylbutanoic acid (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester
Molecular Weight	225.33
InChI	InChI=1S/C13H23NO2/c1-4-9(2)13(15)16-12-7-10-5-6-11(8-12)14(10)3/h9-12H,4-8H2,1-3H3
InChI Key	OGQXAZJUVVPCRL-UHFFFAOYSA-N
Purity	95%+
Complexity	253
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	225.172878976
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Monoisotopic Mass	225.172878976
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the chemical name of Valtropine?

The chemical name of Valtropine is (2S)-2-Methylbutanoic acid (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester.

What is the CAS number of Valtropine?

The CAS number of Valtropine is 495-82-9.

What is the molecular formula of Valtropine?

The molecular formula of Valtropine is C13H23NO2.

What is the molecular weight of Valtropine?

The molecular weight of Valtropine is 225.33.

What is the boiling point of Valtropine?

The predicted boiling point of Valtropine is 281.8±33.0 °C.

What is the predicted density of Valtropine?

The predicted density of Valtropine is 1.03±0.1 g/cm3.

What is the pKa value of Valtropine?

The predicted pKa value of Valtropine is 10.03±0.40.

Where is Valtropine isolated from?

Valtropine is isolated from Duboisia leichardtii.

What are some crystalline salts that can be obtained from Valtropine?

Some crystalline salts that can be obtained from Valtropine include the hydrobromide (m.p. 212°C), aurichloride (m.p. 124°C), and the picrate (m.p. 227°C).

What does Valtropine furnish on alkaline hydrolysis?

On alkaline hydrolysis, Valtropine furnishes tropeine and a-methylbutyric acid.

※ Please kindly note that our products are for research use only.